(3,5-dimethyl-4-methylsulfanylphenyl) N-methylcarbamate

C11H15NO2S — CID 16248

IUPAC(3,5-dimethyl-4-methylsulfanylphenyl) N-methylcarbamate
SMILESCNC(=O)Oc1cc(C)c(SC)c(C)c1
InChIInChI=1S/C11H15NO2S/c1-7-5-9(14-11(13)12-3)6-8(2)10(7)15-4/h5-6H,1-4H3,(H,12,13)
InChIKeyYFBPRJGDJKVWAH-UHFFFAOYSA-N
MW225.31 g/mol
LogP2.74
Rot. Bonds2

About (3,5-dimethyl-4-methylsulfanylphenyl) N-methylcarbamate

(3,5-dimethyl-4-methylsulfanylphenyl) N-methylcarbamate (PubChem CID 16248) has the molecular formula C11H15NO2S and a molecular weight of 225.31 g/mol. Its IUPAC name is (3,5-dimethyl-4-methylsulfanylphenyl) N-methylcarbamate.

Molecular Properties

Compound Name(3,5-dimethyl-4-methylsulfanylphenyl) N-methylcarbamate
PubChem CID16248
Molecular FormulaC11H15NO2S
Molecular Weight225.31 g/mol
Exact Mass225.08
IUPAC Name(3,5-dimethyl-4-methylsulfanylphenyl) N-methylcarbamate
SMILESCNC(=O)Oc1cc(C)c(SC)c(C)c1
InChIInChI=1S/C11H15NO2S/c1-7-5-9(14-11(13)12-3)6-8(2)10(7)15-4/h5-6H,1-4H3,(H,12,13)
InChIKeyYFBPRJGDJKVWAH-UHFFFAOYSA-N
XLogP2.74
TPSA38.33 Ų
H-Bond Donors1
H-Bond Acceptors3
Rotatable Bonds2
Heavy Atoms15
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500225.31
LogP ≤ 52.74
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 103

Analyze (3,5-dimethyl-4-methylsulfanylphenyl) N-methylcarbamate with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of (3,5-dimethyl-4-methylsulfanylphenyl) N-methylcarbamate?
The IUPAC name of (3,5-dimethyl-4-methylsulfanylphenyl) N-methylcarbamate (CID 16248) is (3,5-dimethyl-4-methylsulfanylphenyl) N-methylcarbamate.
What is the SMILES notation for (3,5-dimethyl-4-methylsulfanylphenyl) N-methylcarbamate?
The canonical SMILES for (3,5-dimethyl-4-methylsulfanylphenyl) N-methylcarbamate is CNC(=O)Oc1cc(C)c(SC)c(C)c1.
What is the InChIKey of (3,5-dimethyl-4-methylsulfanylphenyl) N-methylcarbamate?
The InChIKey is YFBPRJGDJKVWAH-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H15NO2S/c1-7-5-9(14-11(13)12-3)6-8(2)10(7)15-4/h5-6H,1-4H3,(H,12,13).
What are the key properties of (3,5-dimethyl-4-methylsulfanylphenyl) N-methylcarbamate?
(3,5-dimethyl-4-methylsulfanylphenyl) N-methylcarbamate has a molecular weight of 225.31 g/mol, XLogP of 2.74, 2 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (3,5-dimethyl-4-methylsulfanylphenyl) N-methylcarbamate is sourced from PubChem (CID 16248), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).