C45H32 — CID 162480250
1,2,3,4,5,6,7,8-octadeuterio-9-[3-(9,9-dimethylfluoren-2-yl)phenyl]-10-naphthalen-2-ylanthracene (PubChem CID 162480250) has the molecular formula C45H32 and a molecular weight of 580.80 g/mol. Its IUPAC name is 1,2,3,4,5,6,7,8-octadeuterio-9-[3-(9,9-dimethylfluoren-2-yl)phenyl]-10-naphthalen-2-ylanthracene.
| Compound Name | 1,2,3,4,5,6,7,8-octadeuterio-9-[3-(9,9-dimethylfluoren-2-yl)phenyl]-10-naphthalen-2-ylanthracene |
|---|---|
| PubChem CID | 162480250 |
| Molecular Formula | C45H32 |
| Molecular Weight | 580.80 g/mol |
| Exact Mass | 580.30 |
| IUPAC Name | 1,2,3,4,5,6,7,8-octadeuterio-9-[3-(9,9-dimethylfluoren-2-yl)phenyl]-10-naphthalen-2-ylanthracene |
| SMILES | [2H]c1c([2H])c([2H])c2c(-c3ccc4ccccc4c3)c3c([2H])c([2H])c([2H])c([2H])c3c(-c3cccc(-c4ccc5c(c4)C(C)(C)c4ccccc4-5)c3)c2c1[2H] |
| InChI | InChI=1S/C45H32/c1-45(2)41-21-10-9-16-35(41)36-25-24-32(28-42(36)45)31-14-11-15-33(27-31)43-37-17-5-7-19-39(37)44(40-20-8-6-18-38(40)43)34-23-22-29-12-3-4-13-30(29)26-34/h3-28H,1-2H3/i5D,6D,7D,8D,17D,18D,19D,20D |
| InChIKey | YXHBVEXJBWPDNN-LJHRBXIWSA-N |
| XLogP | 12.45 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 3 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 580.80 |
| LogP ≤ 5 | 12.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|