C57H39N7 — CID 162481673
9-[2,4-bis(4,6-diphenyl-1,3,5-triazin-2-yl)phenyl]-14,14-dimethyl-9-azapentacyclo[11.7.0.02,10.03,8.015,20]icosa-1(13),2(10),3,5,7,11,15,17,19-nonaene (PubChem CID 162481673) has the molecular formula C57H39N7 and a molecular weight of 821.99 g/mol. Its IUPAC name is 9-[2,4-bis(4,6-diphenyl-1,3,5-triazin-2-yl)phenyl]-14,14-dimethyl-9-azapentacyclo[11.7.0.02,10.03,8.015,20]icosa-1(13),2(10),3,5,7,11,15,17,19-nonaene.
| Compound Name | 9-[2,4-bis(4,6-diphenyl-1,3,5-triazin-2-yl)phenyl]-14,14-dimethyl-9-azapentacyclo[11.7.0.02,10.03,8.015,20]icosa-1(13),2(10),3,5,7,11,15,17,19-nonaene |
|---|---|
| PubChem CID | 162481673 |
| Molecular Formula | C57H39N7 |
| Molecular Weight | 821.99 g/mol |
| Exact Mass | 821.33 |
| IUPAC Name | 9-[2,4-bis(4,6-diphenyl-1,3,5-triazin-2-yl)phenyl]-14,14-dimethyl-9-azapentacyclo[11.7.0.02,10.03,8.015,20]icosa-1(13),2(10),3,5,7,11,15,17,19-nonaene |
| SMILES | CC1(C)c2ccccc2-c2c1ccc1c2c2ccccc2n1-c1ccc(-c2nc(-c3ccccc3)nc(-c3ccccc3)n2)cc1-c1nc(-c2ccccc2)nc(-c2ccccc2)n1 |
| InChI | InChI=1S/C57H39N7/c1-57(2)44-29-17-15-27-41(44)49-45(57)32-34-48-50(49)42-28-16-18-30-46(42)64(48)47-33-31-40(55-60-51(36-19-7-3-8-20-36)58-52(61-55)37-21-9-4-10-22-37)35-43(47)56-62-53(38-23-11-5-12-24-38)59-54(63-56)39-25-13-6-14-26-39/h3-35H,1-2H3 |
| InChIKey | AYIVWKVTIJGTIV-UHFFFAOYSA-N |
| XLogP | 13.46 |
| TPSA | 82.27 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 64 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 821.99 |
| LogP ≤ 5 | 13.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |