C22H18FN5O2S — CID 162481898
N-[(7R)-2-cyano-2-azabicyclo[2.2.1]heptan-7-yl]-5-[4-(4-fluorophenoxy)-3-pyridinyl]-1,3-thiazole-2-carboxamide (PubChem CID 162481898) has the molecular formula C22H18FN5O2S and a molecular weight of 435.48 g/mol. Its IUPAC name is N-[(7R)-2-cyano-2-azabicyclo[2.2.1]heptan-7-yl]-5-[4-(4-fluorophenoxy)-3-pyridinyl]-1,3-thiazole-2-carboxamide.
| Compound Name | N-[(7R)-2-cyano-2-azabicyclo[2.2.1]heptan-7-yl]-5-[4-(4-fluorophenoxy)-3-pyridinyl]-1,3-thiazole-2-carboxamide |
|---|---|
| PubChem CID | 162481898 |
| Molecular Formula | C22H18FN5O2S |
| Molecular Weight | 435.48 g/mol |
| Exact Mass | 435.12 |
| IUPAC Name | N-[(7R)-2-cyano-2-azabicyclo[2.2.1]heptan-7-yl]-5-[4-(4-fluorophenoxy)-3-pyridinyl]-1,3-thiazole-2-carboxamide |
| SMILES | N#CN1CC2CCC1[C@@H]2NC(=O)c1ncc(-c2cnccc2Oc2ccc(F)cc2)s1 |
| InChI | InChI=1S/C22H18FN5O2S/c23-14-2-4-15(5-3-14)30-18-7-8-25-9-16(18)19-10-26-22(31-19)21(29)27-20-13-1-6-17(20)28(11-13)12-24/h2-5,7-10,13,17,20H,1,6,11H2,(H,27,29)/t13?,17?,20-/m1/s1 |
| InChIKey | DMGRPYGZIUBGEH-RJGDCVCESA-N |
| XLogP | 3.81 |
| TPSA | 91.14 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 435.48 |
| LogP ≤ 5 | 3.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'cyanate_/aminonitrile_/thiocyanate', 'substructure': 'N/A'} |
|---|