C21H43N3O9Si2 — CID 162482331
1,3-bis(4-trimethoxysilylbutyl)-5-(4-tritiobutyl)-1,3,5-triazinane-2,4,6-trione (PubChem CID 162482331) has the molecular formula C21H43N3O9Si2 and a molecular weight of 539.77 g/mol. Its IUPAC name is 1,3-bis(4-trimethoxysilylbutyl)-5-(4-tritiobutyl)-1,3,5-triazinane-2,4,6-trione.
| Compound Name | 1,3-bis(4-trimethoxysilylbutyl)-5-(4-tritiobutyl)-1,3,5-triazinane-2,4,6-trione |
|---|---|
| PubChem CID | 162482331 |
| Molecular Formula | C21H43N3O9Si2 |
| Molecular Weight | 539.77 g/mol |
| Exact Mass | 539.26 |
| IUPAC Name | 1,3-bis(4-trimethoxysilylbutyl)-5-(4-tritiobutyl)-1,3,5-triazinane-2,4,6-trione |
| SMILES | [3H]CCCCn1c(=O)n(CCCC[Si](OC)(OC)OC)c(=O)n(CCCC[Si](OC)(OC)OC)c1=O |
| InChI | InChI=1S/C21H43N3O9Si2/c1-8-9-14-22-19(25)23(15-10-12-17-34(28-2,29-3)30-4)21(27)24(20(22)26)16-11-13-18-35(31-5,32-6)33-7/h8-18H2,1-7H3/i1T |
| InChIKey | XLCFYWQPZCLXFK-CNRUNOGKSA-N |
| XLogP | 1.29 |
| TPSA | 121.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 20 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 539.77 |
| LogP ≤ 5 | 1.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|