C26H19BrF3GeNS — CID 162482650
[3-[3-bromo-2-(2,3,6-trifluorophenyl)thieno[2,3-c]pyridin-7-yl]naphthalen-1-yl]-trimethylgermane (PubChem CID 162482650) has the molecular formula C26H19BrF3GeNS and a molecular weight of 587.02 g/mol. Its IUPAC name is [3-[3-bromo-2-(2,3,6-trifluorophenyl)thieno[2,3-c]pyridin-7-yl]naphthalen-1-yl]-trimethylgermane.
| Compound Name | [3-[3-bromo-2-(2,3,6-trifluorophenyl)thieno[2,3-c]pyridin-7-yl]naphthalen-1-yl]-trimethylgermane |
|---|---|
| PubChem CID | 162482650 |
| Molecular Formula | C26H19BrF3GeNS |
| Molecular Weight | 587.02 g/mol |
| Exact Mass | 586.96 |
| IUPAC Name | [3-[3-bromo-2-(2,3,6-trifluorophenyl)thieno[2,3-c]pyridin-7-yl]naphthalen-1-yl]-trimethylgermane |
| SMILES | C[Ge](C)(C)c1cc(-c2nccc3c(Br)c(-c4c(F)ccc(F)c4F)sc23)cc2ccccc12 |
| InChI | InChI=1S/C26H19BrF3GeNS/c1-31(2,3)20-13-15(12-14-6-4-5-7-16(14)20)24-25-17(10-11-32-24)22(27)26(33-25)21-18(28)8-9-19(29)23(21)30/h4-13H,1-3H3 |
| InChIKey | IYXLWGPZAINOFZ-UHFFFAOYSA-N |
| XLogP | 8.51 |
| TPSA | 12.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 33 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 587.02 |
| LogP ≤ 5 | 8.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|