C56H48F12MnN8+4 — CID 162483951
manganese(2+);5,10,15,20-tetrakis[1-(4,4,4-trifluorobutyl)pyridin-1-ium-2-yl]porphyrin-22,24-diide (PubChem CID 162483951) has the molecular formula C56H48F12MnN8+4 and a molecular weight of 1115.97 g/mol. Its IUPAC name is manganese(2+);5,10,15,20-tetrakis[1-(4,4,4-trifluorobutyl)pyridin-1-ium-2-yl]porphyrin-22,24-diide.
| Compound Name | manganese(2+);5,10,15,20-tetrakis[1-(4,4,4-trifluorobutyl)pyridin-1-ium-2-yl]porphyrin-22,24-diide |
|---|---|
| PubChem CID | 162483951 |
| Molecular Formula | C56H48F12MnN8+4 |
| Molecular Weight | 1115.97 g/mol |
| Exact Mass | 1115.32 |
| IUPAC Name | manganese(2+);5,10,15,20-tetrakis[1-(4,4,4-trifluorobutyl)pyridin-1-ium-2-yl]porphyrin-22,24-diide |
| SMILES | FC(F)(F)CCC[n+]1ccccc1-c1c2nc(c(-c3cccc[n+]3CCCC(F)(F)F)c3ccc([n-]3)c(-c3cccc[n+]3CCCC(F)(F)F)c3nc(c(-c4cccc[n+]4CCCC(F)(F)F)c4ccc1[n-]4)C=C3)C=C2.[Mn+2] |
| InChI | InChI=1S/C56H48F12N8.Mn/c57-53(58,59)25-9-33-73-29-5-1-13-45(73)49-37-17-19-39(69-37)50(46-14-2-6-30-74(46)34-10-26-54(60,61)62)41-21-23-43(71-41)52(48-16-4-8-32-76(48)36-12-28-56(66,67)68)44-24-22-42(72-44)51(40-20-18-38(49)70-40)47-15-3-7-31-75(47)35-11-27-55(63,64)65;/h1-8,13-24,29-32H,9-12,25-28,33-36H2;/q2*+2 |
| InChIKey | WFCSAMUFAGHBEQ-UHFFFAOYSA-N |
| XLogP | 13.10 |
| TPSA | 69.50 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 77 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 1115.97 |
| LogP ≤ 5 | 13.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|