C30H54N5O7P — CID 162485390
6-[[3-[(4R)-5-(deuteriomethyl)-4-[[di(propan-2-yl)amino]-(ethyliminomethoxy)phosphanyl]oxyoxolan-2-yl]-5-methyl-2-oxo-1,6-dihydropyrimidin-6-yl]amino]hexyl 4-oxopentanoate (PubChem CID 162485390) has the molecular formula C30H54N5O7P and a molecular weight of 628.77 g/mol. Its IUPAC name is 6-[[3-[(4R)-5-(deuteriomethyl)-4-[[di(propan-2-yl)amino]-(ethyliminomethoxy)phosphanyl]oxyoxolan-2-yl]-5-methyl-2-oxo-1,6-dihydropyrimidin-6-yl]amino]hexyl 4-oxopentanoate.
| Compound Name | 6-[[3-[(4R)-5-(deuteriomethyl)-4-[[di(propan-2-yl)amino]-(ethyliminomethoxy)phosphanyl]oxyoxolan-2-yl]-5-methyl-2-oxo-1,6-dihydropyrimidin-6-yl]amino]hexyl 4-oxopentanoate |
|---|---|
| PubChem CID | 162485390 |
| Molecular Formula | C30H54N5O7P |
| Molecular Weight | 628.77 g/mol |
| Exact Mass | 628.38 |
| IUPAC Name | 6-[[3-[(4R)-5-(deuteriomethyl)-4-[[di(propan-2-yl)amino]-(ethyliminomethoxy)phosphanyl]oxyoxolan-2-yl]-5-methyl-2-oxo-1,6-dihydropyrimidin-6-yl]amino]hexyl 4-oxopentanoate |
| SMILES | [2H]CC1OC(N2C=C(C)C(NCCCCCCOC(=O)CCC(C)=O)NC2=O)C[C@H]1OP(O/C=N/CC)N(C(C)C)C(C)C |
| InChI | InChI=1S/C30H54N5O7P/c1-9-31-20-40-43(35(21(2)3)22(4)5)42-26-18-27(41-25(26)8)34-19-23(6)29(33-30(34)38)32-16-12-10-11-13-17-39-28(37)15-14-24(7)36/h19-22,25-27,29,32H,9-18H2,1-8H3,(H,33,38)/b31-20+/t25?,26-,27?,29?,43?/m1/s1/i8D |
| InChIKey | UBIILUOBLQCNIY-IXRVWZOUSA-N |
| XLogP | 5.23 |
| TPSA | 131.03 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 21 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 628.77 |
| LogP ≤ 5 | 5.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|