C13H10Br2F2N4 — CID 162485697
5-amino-1-(1-bromo-1,1-difluoropropan-2-yl)-3-(4-bromophenyl)pyrazole-4-carbonitrile (PubChem CID 162485697) has the molecular formula C13H10Br2F2N4 and a molecular weight of 420.06 g/mol. Its IUPAC name is 5-amino-1-(1-bromo-1,1-difluoropropan-2-yl)-3-(4-bromophenyl)pyrazole-4-carbonitrile.
| Compound Name | 5-amino-1-(1-bromo-1,1-difluoropropan-2-yl)-3-(4-bromophenyl)pyrazole-4-carbonitrile |
|---|---|
| PubChem CID | 162485697 |
| Molecular Formula | C13H10Br2F2N4 |
| Molecular Weight | 420.06 g/mol |
| Exact Mass | 417.92 |
| IUPAC Name | 5-amino-1-(1-bromo-1,1-difluoropropan-2-yl)-3-(4-bromophenyl)pyrazole-4-carbonitrile |
| SMILES | CC(n1nc(-c2ccc(Br)cc2)c(C#N)c1N)C(F)(F)Br |
| InChI | InChI=1S/C13H10Br2F2N4/c1-7(13(15,16)17)21-12(19)10(6-18)11(20-21)8-2-4-9(14)5-3-8/h2-5,7H,19H2,1H3 |
| InChIKey | QSESIAWGOVMSSH-UHFFFAOYSA-N |
| XLogP | 4.32 |
| TPSA | 67.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.06 |
| LogP ≤ 5 | 4.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|