C39H32BFN4O2 — CID 162486287
4-[4-[4-fluoro-3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]-6-phenyl-1,3,5-triazin-2-yl]-9-phenylcarbazole (PubChem CID 162486287) has the molecular formula C39H32BFN4O2 and a molecular weight of 618.52 g/mol. Its IUPAC name is 4-[4-[4-fluoro-3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]-6-phenyl-1,3,5-triazin-2-yl]-9-phenylcarbazole.
| Compound Name | 4-[4-[4-fluoro-3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]-6-phenyl-1,3,5-triazin-2-yl]-9-phenylcarbazole |
|---|---|
| PubChem CID | 162486287 |
| Molecular Formula | C39H32BFN4O2 |
| Molecular Weight | 618.52 g/mol |
| Exact Mass | 618.26 |
| IUPAC Name | 4-[4-[4-fluoro-3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]-6-phenyl-1,3,5-triazin-2-yl]-9-phenylcarbazole |
| SMILES | CC1(C)OB(c2cc(-c3nc(-c4ccccc4)nc(-c4cccc5c4c4ccccc4n5-c4ccccc4)n3)ccc2F)OC1(C)C |
| InChI | InChI=1S/C39H32BFN4O2/c1-38(2)39(3,4)47-40(46-38)30-24-26(22-23-31(30)41)36-42-35(25-14-7-5-8-15-25)43-37(44-36)29-19-13-21-33-34(29)28-18-11-12-20-32(28)45(33)27-16-9-6-10-17-27/h5-24H,1-4H3 |
| InChIKey | ACRDIXGKMIQFIE-UHFFFAOYSA-N |
| XLogP | 8.41 |
| TPSA | 62.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 618.52 |
| LogP ≤ 5 | 8.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|