C45H31FN6 — CID 162486320
2-(9,9-dimethylfluoren-2-yl)-4-[3-(4,6-diphenyl-1,3,5-triazin-2-yl)-4-fluorophenyl]-6-phenyl-1,3,5-triazine (PubChem CID 162486320) has the molecular formula C45H31FN6 and a molecular weight of 674.78 g/mol. Its IUPAC name is 2-(9,9-dimethylfluoren-2-yl)-4-[3-(4,6-diphenyl-1,3,5-triazin-2-yl)-4-fluorophenyl]-6-phenyl-1,3,5-triazine.
| Compound Name | 2-(9,9-dimethylfluoren-2-yl)-4-[3-(4,6-diphenyl-1,3,5-triazin-2-yl)-4-fluorophenyl]-6-phenyl-1,3,5-triazine |
|---|---|
| PubChem CID | 162486320 |
| Molecular Formula | C45H31FN6 |
| Molecular Weight | 674.78 g/mol |
| Exact Mass | 674.26 |
| IUPAC Name | 2-(9,9-dimethylfluoren-2-yl)-4-[3-(4,6-diphenyl-1,3,5-triazin-2-yl)-4-fluorophenyl]-6-phenyl-1,3,5-triazine |
| SMILES | CC1(C)c2ccccc2-c2ccc(-c3nc(-c4ccccc4)nc(-c4ccc(F)c(-c5nc(-c6ccccc6)nc(-c6ccccc6)n5)c4)n3)cc21 |
| InChI | InChI=1S/C45H31FN6/c1-45(2)36-21-13-12-20-33(36)34-24-22-32(27-37(34)45)43-49-39(28-14-6-3-7-15-28)48-42(50-43)31-23-25-38(46)35(26-31)44-51-40(29-16-8-4-9-17-29)47-41(52-44)30-18-10-5-11-19-30/h3-27H,1-2H3 |
| InChIKey | YFMYEYBVLOYOOE-UHFFFAOYSA-N |
| XLogP | 10.50 |
| TPSA | 77.34 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 52 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 674.78 |
| LogP ≤ 5 | 10.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |