C31H27BFN3O2 — CID 162486355
2-[4-fluoro-3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]-4-naphthalen-2-yl-6-phenyl-1,3,5-triazine (PubChem CID 162486355) has the molecular formula C31H27BFN3O2 and a molecular weight of 503.39 g/mol. Its IUPAC name is 2-[4-fluoro-3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]-4-naphthalen-2-yl-6-phenyl-1,3,5-triazine.
| Compound Name | 2-[4-fluoro-3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]-4-naphthalen-2-yl-6-phenyl-1,3,5-triazine |
|---|---|
| PubChem CID | 162486355 |
| Molecular Formula | C31H27BFN3O2 |
| Molecular Weight | 503.39 g/mol |
| Exact Mass | 503.22 |
| IUPAC Name | 2-[4-fluoro-3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]-4-naphthalen-2-yl-6-phenyl-1,3,5-triazine |
| SMILES | CC1(C)OB(c2cc(-c3nc(-c4ccccc4)nc(-c4ccc5ccccc5c4)n3)ccc2F)OC1(C)C |
| InChI | InChI=1S/C31H27BFN3O2/c1-30(2)31(3,4)38-32(37-30)25-19-24(16-17-26(25)33)29-35-27(21-11-6-5-7-12-21)34-28(36-29)23-15-14-20-10-8-9-13-22(20)18-23/h5-19H,1-4H3 |
| InChIKey | JSIRFDUCUUHKNX-UHFFFAOYSA-N |
| XLogP | 6.46 |
| TPSA | 57.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 503.39 |
| LogP ≤ 5 | 6.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|