About piperidine-3,4-dicarbaldehyde
piperidine-3,4-dicarbaldehyde (PubChem CID 162486555) has the molecular formula C7H11NO2
and a molecular weight of 141.17 g/mol. Its IUPAC name is piperidine-3,4-dicarbaldehyde.
Molecular Properties
| Compound Name | piperidine-3,4-dicarbaldehyde |
| PubChem CID | 162486555 |
| Molecular Formula | C7H11NO2 |
| Molecular Weight | 141.17 g/mol |
| Exact Mass | 141.08 |
| IUPAC Name | piperidine-3,4-dicarbaldehyde |
| SMILES | O=CC1CCNCC1C=O |
| InChI | InChI=1S/C7H11NO2/c9-4-6-1-2-8-3-7(6)5-10/h4-8H,1-3H2 |
| InChIKey | JXNWISPNYNITRZ-UHFFFAOYSA-N |
| XLogP | -0.39 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 141.17 |
| LogP ≤ 5 | -0.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|
Analyze piperidine-3,4-dicarbaldehyde with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of piperidine-3,4-dicarbaldehyde?
The IUPAC name of piperidine-3,4-dicarbaldehyde (CID 162486555) is piperidine-3,4-dicarbaldehyde.
What is the SMILES notation for piperidine-3,4-dicarbaldehyde?
The canonical SMILES for piperidine-3,4-dicarbaldehyde is O=CC1CCNCC1C=O.
What is the InChIKey of piperidine-3,4-dicarbaldehyde?
The InChIKey is JXNWISPNYNITRZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H11NO2/c9-4-6-1-2-8-3-7(6)5-10/h4-8H,1-3H2.
What are the key properties of piperidine-3,4-dicarbaldehyde?
piperidine-3,4-dicarbaldehyde has a molecular weight of 141.17 g/mol, XLogP of -0.39, 2 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for piperidine-3,4-dicarbaldehyde is sourced from PubChem (CID 162486555), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).