About CID 162487233
CID 162487233 (PubChem CID 162487233) has the molecular formula C30H16N4OPtS
and a molecular weight of 675.63 g/mol.
Molecular Properties
| Compound Name | CID 162487233 |
| PubChem CID | 162487233 |
| Molecular Formula | C30H16N4OPtS |
| Molecular Weight | 675.63 g/mol |
| Exact Mass | 675.07 |
| IUPAC Name | — |
| SMILES | [Pt+2].[c-]1c(Oc2[c-]c3c(cc2)c2cc4sc5ccccc5c4cc2n2ccnc32)cccc1-n1cccn1 |
| InChI | InChI=1S/C30H16N4OS.Pt/c1-2-8-28-23(7-1)25-17-27-24(18-29(25)36-28)22-10-9-21(16-26(22)30-31-12-14-33(27)30)35-20-6-3-5-19(15-20)34-13-4-11-32-34;/h1-14,17-18H;/q-2;+2 |
| InChIKey | XUXKGXOPMXDHHQ-UHFFFAOYSA-N |
| XLogP | 7.58 |
| TPSA | 44.35 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 37 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 675.63 |
| LogP ≤ 5 | 7.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|
Analyze CID 162487233 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 162487233?
The IUPAC name of CID 162487233 (CID 162487233) is not available.
What is the SMILES notation for CID 162487233?
The canonical SMILES for CID 162487233 is [Pt+2].[c-]1c(Oc2[c-]c3c(cc2)c2cc4sc5ccccc5c4cc2n2ccnc32)cccc1-n1cccn1.
What is the InChIKey of CID 162487233?
The InChIKey is XUXKGXOPMXDHHQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C30H16N4OS.Pt/c1-2-8-28-23(7-1)25-17-27-24(18-29(25)36-28)22-10-9-21(16-26(22)30-31-12-14-33(27)30)35-20-6-3-5-19(15-20)34-13-4-11-32-34;/h1-14,17-18H;/q-2;+2.
What are the key properties of CID 162487233?
CID 162487233 has a molecular weight of 675.63 g/mol, XLogP of 7.58, 3 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for CID 162487233 is sourced from PubChem (CID 162487233), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).