C16H15F6NO8S2 — CID 162487816
[4-(methylsulfamoyl)phenyl] 5-acetyl-1,1,2,2,3,3-hexafluoro-4-hydroxy-6-oxohept-4-ene-1-sulfonate (PubChem CID 162487816) has the molecular formula C16H15F6NO8S2 and a molecular weight of 527.42 g/mol. Its IUPAC name is [4-(methylsulfamoyl)phenyl] 5-acetyl-1,1,2,2,3,3-hexafluoro-4-hydroxy-6-oxohept-4-ene-1-sulfonate.
| Compound Name | [4-(methylsulfamoyl)phenyl] 5-acetyl-1,1,2,2,3,3-hexafluoro-4-hydroxy-6-oxohept-4-ene-1-sulfonate |
|---|---|
| PubChem CID | 162487816 |
| Molecular Formula | C16H15F6NO8S2 |
| Molecular Weight | 527.42 g/mol |
| Exact Mass | 527.01 |
| IUPAC Name | [4-(methylsulfamoyl)phenyl] 5-acetyl-1,1,2,2,3,3-hexafluoro-4-hydroxy-6-oxohept-4-ene-1-sulfonate |
| SMILES | CNS(=O)(=O)c1ccc(OS(=O)(=O)C(F)(F)C(F)(F)C(F)(F)C(O)=C(C(C)=O)C(C)=O)cc1 |
| InChI | InChI=1S/C16H15F6NO8S2/c1-8(24)12(9(2)25)13(26)14(17,18)15(19,20)16(21,22)33(29,30)31-10-4-6-11(7-5-10)32(27,28)23-3/h4-7,23,26H,1-3H3 |
| InChIKey | AMPZYQGFRJJKQQ-UHFFFAOYSA-N |
| XLogP | 2.16 |
| TPSA | 143.91 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 527.42 |
| LogP ≤ 5 | 2.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|