C21H25FN2O — CID 162488168
N-(4-ethyl-2,6-dimethylhepta-1,6-dien-4-yl)-8-fluoroquinoline-3-carboxamide (PubChem CID 162488168) has the molecular formula C21H25FN2O and a molecular weight of 340.44 g/mol. Its IUPAC name is N-(4-ethyl-2,6-dimethylhepta-1,6-dien-4-yl)-8-fluoroquinoline-3-carboxamide.
| Compound Name | N-(4-ethyl-2,6-dimethylhepta-1,6-dien-4-yl)-8-fluoroquinoline-3-carboxamide |
|---|---|
| PubChem CID | 162488168 |
| Molecular Formula | C21H25FN2O |
| Molecular Weight | 340.44 g/mol |
| Exact Mass | 340.20 |
| IUPAC Name | N-(4-ethyl-2,6-dimethylhepta-1,6-dien-4-yl)-8-fluoroquinoline-3-carboxamide |
| SMILES | C=C(C)CC(CC)(CC(=C)C)NC(=O)c1cnc2c(F)cccc2c1 |
| InChI | InChI=1S/C21H25FN2O/c1-6-21(11-14(2)3,12-15(4)5)24-20(25)17-10-16-8-7-9-18(22)19(16)23-13-17/h7-10,13H,2,4,6,11-12H2,1,3,5H3,(H,24,25) |
| InChIKey | QPYROEMZYHQXIK-UHFFFAOYSA-N |
| XLogP | 5.18 |
| TPSA | 41.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.44 |
| LogP ≤ 5 | 5.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|