C16H17BFNO2 — CID 162488211
1-(8-fluoro-9-oxa-7-azonia-8-boranuidatricyclo[8.4.0.02,7]tetradeca-1(14),2,4,6,10,12-hexaen-8-yl)-2,2-dimethylpropan-1-one (PubChem CID 162488211) has the molecular formula C16H17BFNO2 and a molecular weight of 285.13 g/mol. Its IUPAC name is 1-(8-fluoro-9-oxa-7-azonia-8-boranuidatricyclo[8.4.0.02,7]tetradeca-1(14),2,4,6,10,12-hexaen-8-yl)-2,2-dimethylpropan-1-one.
| Compound Name | 1-(8-fluoro-9-oxa-7-azonia-8-boranuidatricyclo[8.4.0.02,7]tetradeca-1(14),2,4,6,10,12-hexaen-8-yl)-2,2-dimethylpropan-1-one |
|---|---|
| PubChem CID | 162488211 |
| Molecular Formula | C16H17BFNO2 |
| Molecular Weight | 285.13 g/mol |
| Exact Mass | 285.13 |
| IUPAC Name | 1-(8-fluoro-9-oxa-7-azonia-8-boranuidatricyclo[8.4.0.02,7]tetradeca-1(14),2,4,6,10,12-hexaen-8-yl)-2,2-dimethylpropan-1-one |
| SMILES | CC(C)(C)C(=O)[B-]1(F)Oc2ccccc2-c2cccc[n+]21 |
| InChI | InChI=1S/C16H17BFNO2/c1-16(2,3)15(20)17(18)19-11-7-6-9-13(19)12-8-4-5-10-14(12)21-17/h4-11H,1-3H3 |
| InChIKey | LXNCOWQTFQUTLR-UHFFFAOYSA-N |
| XLogP | 2.94 |
| TPSA | 30.18 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.13 |
| LogP ≤ 5 | 2.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|