C21H17MoN2O- — CID 162488894
molybdenum;4-(8,9,10,11-tetrahydro-6H-pyrrolo[3,2-a]phenanthridin-7-yl)benzene-6-id-1-ol (PubChem CID 162488894) has the molecular formula C21H17MoN2O- and a molecular weight of 409.32 g/mol. Its IUPAC name is molybdenum;4-(8,9,10,11-tetrahydro-6H-pyrrolo[3,2-a]phenanthridin-7-yl)benzene-6-id-1-ol.
| Compound Name | molybdenum;4-(8,9,10,11-tetrahydro-6H-pyrrolo[3,2-a]phenanthridin-7-yl)benzene-6-id-1-ol |
|---|---|
| PubChem CID | 162488894 |
| Molecular Formula | C21H17MoN2O- |
| Molecular Weight | 409.32 g/mol |
| Exact Mass | 411.04 |
| IUPAC Name | molybdenum;4-(8,9,10,11-tetrahydro-6H-pyrrolo[3,2-a]phenanthridin-7-yl)benzene-6-id-1-ol |
| SMILES | Oc1[c-]cc(-c2[nH]c3ccc4nccc4c3c3c2CCCC3)cc1.[Mo] |
| InChI | InChI=1S/C21H17N2O.Mo/c24-14-7-5-13(6-8-14)21-16-4-2-1-3-15(16)20-17-11-12-22-18(17)9-10-19(20)23-21;/h5-7,9-12,23-24H,1-4H2;/q-1; |
| InChIKey | GMJFYKFSPNBINW-UHFFFAOYSA-N |
| XLogP | 4.77 |
| TPSA | 48.91 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.32 |
| LogP ≤ 5 | 4.77 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|