C26H22N6O2S2 — CID 162489767
5-benzyl-N-[(6R)-3,8-dimethyl-7-oxo-2-(2-pyridin-3-ylethynyl)-5,6-dihydrothieno[3,2-b][1,4]thiazepin-6-yl]-1H-1,2,4-triazole-3-carboxamide (PubChem CID 162489767) has the molecular formula C26H22N6O2S2 and a molecular weight of 514.64 g/mol. Its IUPAC name is 5-benzyl-N-[(6R)-3,8-dimethyl-7-oxo-2-(2-pyridin-3-ylethynyl)-5,6-dihydrothieno[3,2-b][1,4]thiazepin-6-yl]-1H-1,2,4-triazole-3-carboxamide.
| Compound Name | 5-benzyl-N-[(6R)-3,8-dimethyl-7-oxo-2-(2-pyridin-3-ylethynyl)-5,6-dihydrothieno[3,2-b][1,4]thiazepin-6-yl]-1H-1,2,4-triazole-3-carboxamide |
|---|---|
| PubChem CID | 162489767 |
| Molecular Formula | C26H22N6O2S2 |
| Molecular Weight | 514.64 g/mol |
| Exact Mass | 514.12 |
| IUPAC Name | 5-benzyl-N-[(6R)-3,8-dimethyl-7-oxo-2-(2-pyridin-3-ylethynyl)-5,6-dihydrothieno[3,2-b][1,4]thiazepin-6-yl]-1H-1,2,4-triazole-3-carboxamide |
| SMILES | Cc1c(C#Cc2cccnc2)sc2c1SC[C@H](NC(=O)c1n[nH]c(Cc3ccccc3)n1)C(=O)N2C |
| InChI | InChI=1S/C26H22N6O2S2/c1-16-20(11-10-18-9-6-12-27-14-18)36-26-22(16)35-15-19(25(34)32(26)2)28-24(33)23-29-21(30-31-23)13-17-7-4-3-5-8-17/h3-9,12,14,19H,13,15H2,1-2H3,(H,28,33)(H,29,30,31)/t19-/m0/s1 |
| InChIKey | VLXINSMUJHOETP-IBGZPJMESA-N |
| XLogP | 3.43 |
| TPSA | 103.87 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 514.64 |
| LogP ≤ 5 | 3.43 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|