C17H19F3N2O2 — CID 162489932
(4aS,8aR)-N-[3-(difluoromethyl)-4-fluorophenyl]-4-oxo-2,3,4a,5,6,7,8,8a-octahydroquinoline-1-carboxamide (PubChem CID 162489932) has the molecular formula C17H19F3N2O2 and a molecular weight of 340.35 g/mol. Its IUPAC name is (4aS,8aR)-N-[3-(difluoromethyl)-4-fluorophenyl]-4-oxo-2,3,4a,5,6,7,8,8a-octahydroquinoline-1-carboxamide.
| Compound Name | (4aS,8aR)-N-[3-(difluoromethyl)-4-fluorophenyl]-4-oxo-2,3,4a,5,6,7,8,8a-octahydroquinoline-1-carboxamide |
|---|---|
| PubChem CID | 162489932 |
| Molecular Formula | C17H19F3N2O2 |
| Molecular Weight | 340.35 g/mol |
| Exact Mass | 340.14 |
| IUPAC Name | (4aS,8aR)-N-[3-(difluoromethyl)-4-fluorophenyl]-4-oxo-2,3,4a,5,6,7,8,8a-octahydroquinoline-1-carboxamide |
| SMILES | O=C1CCN(C(=O)Nc2ccc(F)c(C(F)F)c2)[C@@H]2CCCC[C@H]12 |
| InChI | InChI=1S/C17H19F3N2O2/c18-13-6-5-10(9-12(13)16(19)20)21-17(24)22-8-7-15(23)11-3-1-2-4-14(11)22/h5-6,9,11,14,16H,1-4,7-8H2,(H,21,24)/t11-,14+/m0/s1 |
| InChIKey | RYRGPZHWHWAJLW-SMDDNHRTSA-N |
| XLogP | 4.13 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.35 |
| LogP ≤ 5 | 4.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |