C56H50N2Si — CID 162490215
[3-[4-(3,6-ditert-butylcarbazol-9-yl)carbazol-9-yl]phenyl]-triphenylsilane (PubChem CID 162490215) has the molecular formula C56H50N2Si and a molecular weight of 779.12 g/mol. Its IUPAC name is [3-[4-(3,6-ditert-butylcarbazol-9-yl)carbazol-9-yl]phenyl]-triphenylsilane.
| Compound Name | [3-[4-(3,6-ditert-butylcarbazol-9-yl)carbazol-9-yl]phenyl]-triphenylsilane |
|---|---|
| PubChem CID | 162490215 |
| Molecular Formula | C56H50N2Si |
| Molecular Weight | 779.12 g/mol |
| Exact Mass | 778.37 |
| IUPAC Name | [3-[4-(3,6-ditert-butylcarbazol-9-yl)carbazol-9-yl]phenyl]-triphenylsilane |
| SMILES | CC(C)(C)c1ccc2c(c1)c1cc(C(C)(C)C)ccc1n2-c1cccc2c1c1ccccc1n2-c1cccc([Si](c2ccccc2)(c2ccccc2)c2ccccc2)c1 |
| InChI | InChI=1S/C56H50N2Si/c1-55(2,3)39-32-34-50-47(36-39)48-37-40(56(4,5)6)33-35-51(48)58(50)53-31-19-30-52-54(53)46-28-16-17-29-49(46)57(52)41-20-18-27-45(38-41)59(42-21-10-7-11-22-42,43-23-12-8-13-24-43)44-25-14-9-15-26-44/h7-38H,1-6H3 |
| InChIKey | BFPISMPRCOHBER-UHFFFAOYSA-N |
| XLogP | 11.85 |
| TPSA | 9.86 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 59 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 779.12 |
| LogP ≤ 5 | 11.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|