C15H21F2N — CID 162490790
1-[(3,5-difluorophenyl)methyl]-4-propan-2-ylpiperidine (PubChem CID 162490790) has the molecular formula C15H21F2N and a molecular weight of 253.34 g/mol. Its IUPAC name is 1-[(3,5-difluorophenyl)methyl]-4-propan-2-ylpiperidine.
| Compound Name | 1-[(3,5-difluorophenyl)methyl]-4-propan-2-ylpiperidine |
|---|---|
| PubChem CID | 162490790 |
| Molecular Formula | C15H21F2N |
| Molecular Weight | 253.34 g/mol |
| Exact Mass | 253.16 |
| IUPAC Name | 1-[(3,5-difluorophenyl)methyl]-4-propan-2-ylpiperidine |
| SMILES | CC(C)C1CCN(Cc2cc(F)cc(F)c2)CC1 |
| InChI | InChI=1S/C15H21F2N/c1-11(2)13-3-5-18(6-4-13)10-12-7-14(16)9-15(17)8-12/h7-9,11,13H,3-6,10H2,1-2H3 |
| InChIKey | UJDHKBCZQRCRQS-UHFFFAOYSA-N |
| XLogP | 3.83 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 253.34 |
| LogP ≤ 5 | 3.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |