C19H24CuN4O3 — CID 162491005
1-butyl-6-methoxy-4-methyl-5-[(4-methylphenyl)diazenyl]-2-oxopyridine-3-carbonitrile;copper;hydrate (PubChem CID 162491005) has the molecular formula C19H24CuN4O3 and a molecular weight of 419.97 g/mol. Its IUPAC name is 1-butyl-6-methoxy-4-methyl-5-[(4-methylphenyl)diazenyl]-2-oxopyridine-3-carbonitrile;copper;hydrate.
| Compound Name | 1-butyl-6-methoxy-4-methyl-5-[(4-methylphenyl)diazenyl]-2-oxopyridine-3-carbonitrile;copper;hydrate |
|---|---|
| PubChem CID | 162491005 |
| Molecular Formula | C19H24CuN4O3 |
| Molecular Weight | 419.97 g/mol |
| Exact Mass | 419.11 |
| IUPAC Name | 1-butyl-6-methoxy-4-methyl-5-[(4-methylphenyl)diazenyl]-2-oxopyridine-3-carbonitrile;copper;hydrate |
| SMILES | CCCCn1c(OC)c(/N=N/c2ccc(C)cc2)c(C)c(C#N)c1=O.O.[Cu] |
| InChI | InChI=1S/C19H22N4O2.Cu.H2O/c1-5-6-11-23-18(24)16(12-20)14(3)17(19(23)25-4)22-21-15-9-7-13(2)8-10-15;;/h7-10H,5-6,11H2,1-4H3;;1H2/b22-21+;; |
| InChIKey | FMUMBJOLTRHZGN-ZPZFBZIMSA-N |
| XLogP | 3.73 |
| TPSA | 111.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.97 |
| LogP ≤ 5 | 3.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'} |
|---|