C8H5N2O4SY- — CID 162491161
1,1-dioxo-4,7-dihydro-1λ6,2,4-benzothiadiazin-7-ide-3-carboxylic acid;yttrium (PubChem CID 162491161) has the molecular formula C8H5N2O4SY- and a molecular weight of 314.11 g/mol. Its IUPAC name is 1,1-dioxo-4,7-dihydro-1λ6,2,4-benzothiadiazin-7-ide-3-carboxylic acid;yttrium.
| Compound Name | 1,1-dioxo-4,7-dihydro-1λ6,2,4-benzothiadiazin-7-ide-3-carboxylic acid;yttrium |
|---|---|
| PubChem CID | 162491161 |
| Molecular Formula | C8H5N2O4SY- |
| Molecular Weight | 314.11 g/mol |
| Exact Mass | 313.90 |
| IUPAC Name | 1,1-dioxo-4,7-dihydro-1λ6,2,4-benzothiadiazin-7-ide-3-carboxylic acid;yttrium |
| SMILES | O=C(O)C1=NS(=O)(=O)c2c[c-]ccc2N1.[Y] |
| InChI | InChI=1S/C8H5N2O4S.Y/c11-8(12)7-9-5-3-1-2-4-6(5)15(13,14)10-7;/h1,3-4H,(H,9,10)(H,11,12);/q-1; |
| InChIKey | URGCWMCOFZSSMU-UHFFFAOYSA-N |
| XLogP | 0.08 |
| TPSA | 95.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.11 |
| LogP ≤ 5 | 0.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|