C16H22N4OSSi — CID 162491498
trimethyl-[2-[[6-(3-methyl-1,2,4-thiadiazol-5-yl)pyrrolo[2,3-b]pyridin-1-yl]methoxy]ethyl]silane (PubChem CID 162491498) has the molecular formula C16H22N4OSSi and a molecular weight of 346.53 g/mol. Its IUPAC name is trimethyl-[2-[[6-(3-methyl-1,2,4-thiadiazol-5-yl)pyrrolo[2,3-b]pyridin-1-yl]methoxy]ethyl]silane.
| Compound Name | trimethyl-[2-[[6-(3-methyl-1,2,4-thiadiazol-5-yl)pyrrolo[2,3-b]pyridin-1-yl]methoxy]ethyl]silane |
|---|---|
| PubChem CID | 162491498 |
| Molecular Formula | C16H22N4OSSi |
| Molecular Weight | 346.53 g/mol |
| Exact Mass | 346.13 |
| IUPAC Name | trimethyl-[2-[[6-(3-methyl-1,2,4-thiadiazol-5-yl)pyrrolo[2,3-b]pyridin-1-yl]methoxy]ethyl]silane |
| SMILES | Cc1nsc(-c2ccc3ccn(COCC[Si](C)(C)C)c3n2)n1 |
| InChI | InChI=1S/C16H22N4OSSi/c1-12-17-16(22-19-12)14-6-5-13-7-8-20(15(13)18-14)11-21-9-10-23(2,3)4/h5-8H,9-11H2,1-4H3 |
| InChIKey | UFNWRBKQMSBWSJ-UHFFFAOYSA-N |
| XLogP | 4.18 |
| TPSA | 52.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.53 |
| LogP ≤ 5 | 4.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|