C28H32F3N7O4 — CID 162491501
tert-butyl (3R,4R)-3-[[4-[6-(3,5-dimethyl-1,2-oxazol-4-yl)-1H-pyrrolo[2,3-b]pyridin-3-yl]-5-(trifluoromethyl)pyrimidin-2-yl]amino]-4-methoxypiperidine-1-carboxylate (PubChem CID 162491501) has the molecular formula C28H32F3N7O4 and a molecular weight of 587.60 g/mol. Its IUPAC name is tert-butyl (3R,4R)-3-[[4-[6-(3,5-dimethyl-1,2-oxazol-4-yl)-1H-pyrrolo[2,3-b]pyridin-3-yl]-5-(trifluoromethyl)pyrimidin-2-yl]amino]-4-methoxypiperidine-1-carboxylate.
| Compound Name | tert-butyl (3R,4R)-3-[[4-[6-(3,5-dimethyl-1,2-oxazol-4-yl)-1H-pyrrolo[2,3-b]pyridin-3-yl]-5-(trifluoromethyl)pyrimidin-2-yl]amino]-4-methoxypiperidine-1-carboxylate |
|---|---|
| PubChem CID | 162491501 |
| Molecular Formula | C28H32F3N7O4 |
| Molecular Weight | 587.60 g/mol |
| Exact Mass | 587.25 |
| IUPAC Name | tert-butyl (3R,4R)-3-[[4-[6-(3,5-dimethyl-1,2-oxazol-4-yl)-1H-pyrrolo[2,3-b]pyridin-3-yl]-5-(trifluoromethyl)pyrimidin-2-yl]amino]-4-methoxypiperidine-1-carboxylate |
| SMILES | CO[C@@H]1CCN(C(=O)OC(C)(C)C)C[C@H]1Nc1ncc(C(F)(F)F)c(-c2c[nH]c3nc(-c4c(C)noc4C)ccc23)n1 |
| InChI | InChI=1S/C28H32F3N7O4/c1-14-22(15(2)42-37-14)19-8-7-16-17(11-32-24(16)34-19)23-18(28(29,30)31)12-33-25(36-23)35-20-13-38(10-9-21(20)40-6)26(39)41-27(3,4)5/h7-8,11-12,20-21H,9-10,13H2,1-6H3,(H,32,34)(H,33,35,36)/t20-,21-/m1/s1 |
| InChIKey | IMSIGJQDSLHIKV-NHCUHLMSSA-N |
| XLogP | 5.75 |
| TPSA | 131.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 587.60 |
| LogP ≤ 5 | 5.75 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |