C22H33BN4O3SSi — CID 162491555
trimethyl-[2-[[6-(3-methyl-1,2,4-thiadiazol-5-yl)-3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyrrolo[2,3-b]pyridin-1-yl]methoxy]ethyl]silane (PubChem CID 162491555) has the molecular formula C22H33BN4O3SSi and a molecular weight of 472.50 g/mol. Its IUPAC name is trimethyl-[2-[[6-(3-methyl-1,2,4-thiadiazol-5-yl)-3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyrrolo[2,3-b]pyridin-1-yl]methoxy]ethyl]silane.
| Compound Name | trimethyl-[2-[[6-(3-methyl-1,2,4-thiadiazol-5-yl)-3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyrrolo[2,3-b]pyridin-1-yl]methoxy]ethyl]silane |
|---|---|
| PubChem CID | 162491555 |
| Molecular Formula | C22H33BN4O3SSi |
| Molecular Weight | 472.50 g/mol |
| Exact Mass | 472.21 |
| IUPAC Name | trimethyl-[2-[[6-(3-methyl-1,2,4-thiadiazol-5-yl)-3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyrrolo[2,3-b]pyridin-1-yl]methoxy]ethyl]silane |
| SMILES | Cc1nsc(-c2ccc3c(B4OC(C)(C)C(C)(C)O4)cn(COCC[Si](C)(C)C)c3n2)n1 |
| InChI | InChI=1S/C22H33BN4O3SSi/c1-15-24-20(31-26-15)18-10-9-16-17(23-29-21(2,3)22(4,5)30-23)13-27(19(16)25-18)14-28-11-12-32(6,7)8/h9-10,13H,11-12,14H2,1-8H3 |
| InChIKey | LCZKAKJTKSSXKS-UHFFFAOYSA-N |
| XLogP | 4.47 |
| TPSA | 71.29 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 472.50 |
| LogP ≤ 5 | 4.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|