About (4S)-8-tert-butyl-3,3-difluoro-8-azaspiro[4.5]decan-4-amine
(4S)-8-tert-butyl-3,3-difluoro-8-azaspiro[4.5]decan-4-amine (PubChem CID 162492906) has the molecular formula C13H24F2N2
and a molecular weight of 246.34 g/mol. Its IUPAC name is (4S)-8-tert-butyl-3,3-difluoro-8-azaspiro[4.5]decan-4-amine.
Molecular Properties
| Compound Name | (4S)-8-tert-butyl-3,3-difluoro-8-azaspiro[4.5]decan-4-amine |
| PubChem CID | 162492906 |
| Molecular Formula | C13H24F2N2 |
| Molecular Weight | 246.34 g/mol |
| Exact Mass | 246.19 |
| IUPAC Name | (4S)-8-tert-butyl-3,3-difluoro-8-azaspiro[4.5]decan-4-amine |
| SMILES | CC(C)(C)N1CCC2(CC1)CCC(F)(F)[C@H]2N |
| InChI | InChI=1S/C13H24F2N2/c1-11(2,3)17-8-6-12(7-9-17)4-5-13(14,15)10(12)16/h10H,4-9,16H2,1-3H3/t10-/m0/s1 |
| InChIKey | PJDKBEGPFSLPMV-JTQLQIEISA-N |
| XLogP | 2.62 |
| TPSA | 29.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 246.34 |
| LogP ≤ 5 | 2.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze (4S)-8-tert-butyl-3,3-difluoro-8-azaspiro[4.5]decan-4-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (4S)-8-tert-butyl-3,3-difluoro-8-azaspiro[4.5]decan-4-amine?
The IUPAC name of (4S)-8-tert-butyl-3,3-difluoro-8-azaspiro[4.5]decan-4-amine (CID 162492906) is (4S)-8-tert-butyl-3,3-difluoro-8-azaspiro[4.5]decan-4-amine.
What is the SMILES notation for (4S)-8-tert-butyl-3,3-difluoro-8-azaspiro[4.5]decan-4-amine?
The canonical SMILES for (4S)-8-tert-butyl-3,3-difluoro-8-azaspiro[4.5]decan-4-amine is CC(C)(C)N1CCC2(CC1)CCC(F)(F)[C@H]2N.
What is the InChIKey of (4S)-8-tert-butyl-3,3-difluoro-8-azaspiro[4.5]decan-4-amine?
The InChIKey is PJDKBEGPFSLPMV-JTQLQIEISA-N. The full InChI is InChI=1S/C13H24F2N2/c1-11(2,3)17-8-6-12(7-9-17)4-5-13(14,15)10(12)16/h10H,4-9,16H2,1-3H3/t10-/m0/s1.
What are the key properties of (4S)-8-tert-butyl-3,3-difluoro-8-azaspiro[4.5]decan-4-amine?
(4S)-8-tert-butyl-3,3-difluoro-8-azaspiro[4.5]decan-4-amine has a molecular weight of 246.34 g/mol, XLogP of 2.62, 0 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (4S)-8-tert-butyl-3,3-difluoro-8-azaspiro[4.5]decan-4-amine is sourced from PubChem (CID 162492906), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).