C27H26F3N5O2 — CID 162493561
1-[7-[2-isocyano-3-(5-methyl-1H-indazol-4-yl)-4-(2,2,2-trifluoroethoxy)phenyl]-2,7-diazaspiro[3.5]nonan-2-yl]prop-2-en-1-one (PubChem CID 162493561) has the molecular formula C27H26F3N5O2 and a molecular weight of 509.53 g/mol. Its IUPAC name is 1-[7-[2-isocyano-3-(5-methyl-1H-indazol-4-yl)-4-(2,2,2-trifluoroethoxy)phenyl]-2,7-diazaspiro[3.5]nonan-2-yl]prop-2-en-1-one.
| Compound Name | 1-[7-[2-isocyano-3-(5-methyl-1H-indazol-4-yl)-4-(2,2,2-trifluoroethoxy)phenyl]-2,7-diazaspiro[3.5]nonan-2-yl]prop-2-en-1-one |
|---|---|
| PubChem CID | 162493561 |
| Molecular Formula | C27H26F3N5O2 |
| Molecular Weight | 509.53 g/mol |
| Exact Mass | 509.20 |
| IUPAC Name | 1-[7-[2-isocyano-3-(5-methyl-1H-indazol-4-yl)-4-(2,2,2-trifluoroethoxy)phenyl]-2,7-diazaspiro[3.5]nonan-2-yl]prop-2-en-1-one |
| SMILES | [C-]#[N+]c1c(N2CCC3(CC2)CN(C(=O)C=C)C3)ccc(OCC(F)(F)F)c1-c1c(C)ccc2[nH]ncc12 |
| InChI | InChI=1S/C27H26F3N5O2/c1-4-22(36)35-14-26(15-35)9-11-34(12-10-26)20-7-8-21(37-16-27(28,29)30)24(25(20)31-3)23-17(2)5-6-19-18(23)13-32-33-19/h4-8,13H,1,9-12,14-16H2,2H3,(H,32,33) |
| InChIKey | BSMRHMYLMOJUPQ-UHFFFAOYSA-N |
| XLogP | 5.65 |
| TPSA | 65.82 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 509.53 |
| LogP ≤ 5 | 5.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'}, {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|