C54H37N3S2 — CID 162493627
6,7,8,9-tetradeuterio-1-N,1-N,3-N-triphenyl-3-N-[8-(N-phenylanilino)dibenzothiophen-3-yl]dibenzothiophene-1,3-diamine (PubChem CID 162493627) has the molecular formula C54H37N3S2 and a molecular weight of 796.07 g/mol. Its IUPAC name is 6,7,8,9-tetradeuterio-1-N,1-N,3-N-triphenyl-3-N-[8-(N-phenylanilino)dibenzothiophen-3-yl]dibenzothiophene-1,3-diamine.
| Compound Name | 6,7,8,9-tetradeuterio-1-N,1-N,3-N-triphenyl-3-N-[8-(N-phenylanilino)dibenzothiophen-3-yl]dibenzothiophene-1,3-diamine |
|---|---|
| PubChem CID | 162493627 |
| Molecular Formula | C54H37N3S2 |
| Molecular Weight | 796.07 g/mol |
| Exact Mass | 795.27 |
| IUPAC Name | 6,7,8,9-tetradeuterio-1-N,1-N,3-N-triphenyl-3-N-[8-(N-phenylanilino)dibenzothiophen-3-yl]dibenzothiophene-1,3-diamine |
| SMILES | [2H]c1c([2H])c([2H])c2c(sc3cc(N(c4ccccc4)c4ccc5c(c4)sc4ccc(N(c6ccccc6)c6ccccc6)cc45)cc(N(c4ccccc4)c4ccccc4)c32)c1[2H] |
| InChI | InChI=1S/C54H37N3S2/c1-6-18-38(19-7-1)55(39-20-8-2-9-21-39)43-31-33-51-48(34-43)46-32-30-44(36-52(46)58-51)56(40-22-10-3-11-23-40)45-35-49(54-47-28-16-17-29-50(47)59-53(54)37-45)57(41-24-12-4-13-25-41)42-26-14-5-15-27-42/h1-37H/i16D,17D,28D,29D |
| InChIKey | KXXDJEAFGHYWAE-ZUHILWPRSA-N |
| XLogP | 16.83 |
| TPSA | 9.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 59 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 796.07 |
| LogP ≤ 5 | 16.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |