C52H53N3O2 — CID 162494108
2-[4-tert-butyl-6-[9,11-ditert-butyl-3-(2,6-dimethylphenyl)imidazo[1,2-f]phenanthridin-2-yl]oxy-2-pyridinyl]-4-phenylphenol (PubChem CID 162494108) has the molecular formula C52H53N3O2 and a molecular weight of 752.02 g/mol. Its IUPAC name is 2-[4-tert-butyl-6-[9,11-ditert-butyl-3-(2,6-dimethylphenyl)imidazo[1,2-f]phenanthridin-2-yl]oxy-2-pyridinyl]-4-phenylphenol.
| Compound Name | 2-[4-tert-butyl-6-[9,11-ditert-butyl-3-(2,6-dimethylphenyl)imidazo[1,2-f]phenanthridin-2-yl]oxy-2-pyridinyl]-4-phenylphenol |
|---|---|
| PubChem CID | 162494108 |
| Molecular Formula | C52H53N3O2 |
| Molecular Weight | 752.02 g/mol |
| Exact Mass | 751.41 |
| IUPAC Name | 2-[4-tert-butyl-6-[9,11-ditert-butyl-3-(2,6-dimethylphenyl)imidazo[1,2-f]phenanthridin-2-yl]oxy-2-pyridinyl]-4-phenylphenol |
| SMILES | Cc1cccc(C)c1-c1c(Oc2cc(C(C)(C)C)cc(-c3cc(-c4ccccc4)ccc3O)n2)nc2c3cc(C(C)(C)C)cc(C(C)(C)C)c3c3ccccc3n12 |
| InChI | InChI=1S/C52H53N3O2/c1-31-18-17-19-32(2)45(31)47-49(54-48-39-27-35(50(3,4)5)28-40(52(9,10)11)46(39)37-22-15-16-23-42(37)55(47)48)57-44-30-36(51(6,7)8)29-41(53-44)38-26-34(24-25-43(38)56)33-20-13-12-14-21-33/h12-30,56H,1-11H3 |
| InChIKey | VWKAYCKILCIMJW-UHFFFAOYSA-N |
| XLogP | 14.04 |
| TPSA | 59.65 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 57 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 752.02 |
| LogP ≤ 5 | 14.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|