About 3-methyl-2-(2-methylphenyl)-1-phenylimidazo[4,5-b]pyrazin-3-ium
3-methyl-2-(2-methylphenyl)-1-phenylimidazo[4,5-b]pyrazin-3-ium (PubChem CID 162494344) has the molecular formula C19H17N4+
and a molecular weight of 301.37 g/mol. Its IUPAC name is 3-methyl-2-(2-methylphenyl)-1-phenylimidazo[4,5-b]pyrazin-3-ium.
Molecular Properties
| Compound Name | 3-methyl-2-(2-methylphenyl)-1-phenylimidazo[4,5-b]pyrazin-3-ium |
| PubChem CID | 162494344 |
| Molecular Formula | C19H17N4+ |
| Molecular Weight | 301.37 g/mol |
| Exact Mass | 301.14 |
| IUPAC Name | 3-methyl-2-(2-methylphenyl)-1-phenylimidazo[4,5-b]pyrazin-3-ium |
| SMILES | Cc1ccccc1-c1n(-c2ccccc2)c2nccnc2[n+]1C |
| InChI | InChI=1S/C19H17N4/c1-14-8-6-7-11-16(14)19-22(2)17-18(21-13-12-20-17)23(19)15-9-4-3-5-10-15/h3-13H,1-2H3/q+1 |
| InChIKey | UKULBOQRNJWNKV-UHFFFAOYSA-N |
| XLogP | 3.22 |
| TPSA | 34.59 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 301.37 |
| LogP ≤ 5 | 3.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|
Analyze 3-methyl-2-(2-methylphenyl)-1-phenylimidazo[4,5-b]pyrazin-3-ium with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-methyl-2-(2-methylphenyl)-1-phenylimidazo[4,5-b]pyrazin-3-ium?
The IUPAC name of 3-methyl-2-(2-methylphenyl)-1-phenylimidazo[4,5-b]pyrazin-3-ium (CID 162494344) is 3-methyl-2-(2-methylphenyl)-1-phenylimidazo[4,5-b]pyrazin-3-ium.
What is the SMILES notation for 3-methyl-2-(2-methylphenyl)-1-phenylimidazo[4,5-b]pyrazin-3-ium?
The canonical SMILES for 3-methyl-2-(2-methylphenyl)-1-phenylimidazo[4,5-b]pyrazin-3-ium is Cc1ccccc1-c1n(-c2ccccc2)c2nccnc2[n+]1C.
What is the InChIKey of 3-methyl-2-(2-methylphenyl)-1-phenylimidazo[4,5-b]pyrazin-3-ium?
The InChIKey is UKULBOQRNJWNKV-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H17N4/c1-14-8-6-7-11-16(14)19-22(2)17-18(21-13-12-20-17)23(19)15-9-4-3-5-10-15/h3-13H,1-2H3/q+1.
What are the key properties of 3-methyl-2-(2-methylphenyl)-1-phenylimidazo[4,5-b]pyrazin-3-ium?
3-methyl-2-(2-methylphenyl)-1-phenylimidazo[4,5-b]pyrazin-3-ium has a molecular weight of 301.37 g/mol, XLogP of 3.22, 2 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3-methyl-2-(2-methylphenyl)-1-phenylimidazo[4,5-b]pyrazin-3-ium is sourced from PubChem (CID 162494344), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).