C84H102N8O4S3 — CID 162494632
4,7-bis[4-methyl-6-(4-octoxy-N-(4-octoxyphenyl)anilino)thieno[3,2-b]indol-2-yl]-2,1,3-benzothiadiazole-5,6-diamine (PubChem CID 162494632) has the molecular formula C84H102N8O4S3 and a molecular weight of 1383.99 g/mol. Its IUPAC name is 4,7-bis[4-methyl-6-(4-octoxy-N-(4-octoxyphenyl)anilino)thieno[3,2-b]indol-2-yl]-2,1,3-benzothiadiazole-5,6-diamine.
| Compound Name | 4,7-bis[4-methyl-6-(4-octoxy-N-(4-octoxyphenyl)anilino)thieno[3,2-b]indol-2-yl]-2,1,3-benzothiadiazole-5,6-diamine |
|---|---|
| PubChem CID | 162494632 |
| Molecular Formula | C84H102N8O4S3 |
| Molecular Weight | 1383.99 g/mol |
| Exact Mass | 1382.72 |
| IUPAC Name | 4,7-bis[4-methyl-6-(4-octoxy-N-(4-octoxyphenyl)anilino)thieno[3,2-b]indol-2-yl]-2,1,3-benzothiadiazole-5,6-diamine |
| SMILES | CCCCCCCCOc1ccc(N(c2ccc(OCCCCCCCC)cc2)c2ccc3c4sc(-c5c(N)c(N)c(-c6cc7c(s6)c6ccc(N(c8ccc(OCCCCCCCC)cc8)c8ccc(OCCCCCCCC)cc8)cc6n7C)c6nsnc56)cc4n(C)c3c2)cc1 |
| InChI | InChI=1S/C84H102N8O4S3/c1-7-11-15-19-23-27-51-93-65-41-31-59(32-42-65)91(60-33-43-66(44-34-60)94-52-28-24-20-16-12-8-2)63-39-49-69-71(55-63)89(5)73-57-75(97-83(69)73)77-79(85)80(86)78(82-81(77)87-99-88-82)76-58-74-84(98-76)70-50-40-64(56-72(70)90(74)6)92(61-35-45-67(46-36-61)95-53-29-25-21-17-13-9-3)62-37-47-68(48-38-62)96-54-30-26-22-18-14-10-4/h31-50,55-58H,7-30,51-54,85-86H2,1-6H3 |
| InChIKey | AGDZVPDMZCWMSE-UHFFFAOYSA-N |
| XLogP | 25.50 |
| TPSA | 131.08 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 15 |
| Rotatable Bonds | 40 |
| Heavy Atoms | 99 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 1383.99 |
| LogP ≤ 5 | 25.50 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 15 |
| Structural Alerts | {'alert_name': 'dyes5A(27)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|