C17H29NO6 — CID 162494935
5-hydroxy-2-(2-hydroxyethyl)-1,1,3,3,10,10-hexamethyl-7,12-dioxa-2-azaspiro[5.6]dodecane-8,11-dione (PubChem CID 162494935) has the molecular formula C17H29NO6 and a molecular weight of 343.42 g/mol. Its IUPAC name is 5-hydroxy-2-(2-hydroxyethyl)-1,1,3,3,10,10-hexamethyl-7,12-dioxa-2-azaspiro[5.6]dodecane-8,11-dione.
| Compound Name | 5-hydroxy-2-(2-hydroxyethyl)-1,1,3,3,10,10-hexamethyl-7,12-dioxa-2-azaspiro[5.6]dodecane-8,11-dione |
|---|---|
| PubChem CID | 162494935 |
| Molecular Formula | C17H29NO6 |
| Molecular Weight | 343.42 g/mol |
| Exact Mass | 343.20 |
| IUPAC Name | 5-hydroxy-2-(2-hydroxyethyl)-1,1,3,3,10,10-hexamethyl-7,12-dioxa-2-azaspiro[5.6]dodecane-8,11-dione |
| SMILES | CC1(C)CC(=O)OC2(OC1=O)C(O)CC(C)(C)N(CCO)C2(C)C |
| InChI | InChI=1S/C17H29NO6/c1-14(2)10-12(21)23-17(24-13(14)22)11(20)9-15(3,4)18(7-8-19)16(17,5)6/h11,19-20H,7-10H2,1-6H3 |
| InChIKey | XRJQJOUCVPQUQD-UHFFFAOYSA-N |
| XLogP | 0.82 |
| TPSA | 96.30 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.42 |
| LogP ≤ 5 | 0.82 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |