About N-[(E)-1-chloro-2-(1H-1,2,4-triazol-5-yl)ethenyl]methanimine
N-[(E)-1-chloro-2-(1H-1,2,4-triazol-5-yl)ethenyl]methanimine (PubChem CID 162496364) has the molecular formula C5H4ClN4+
and a molecular weight of 155.57 g/mol. Its IUPAC name is N-[(E)-1-chloro-2-(1H-1,2,4-triazol-5-yl)ethenyl]methanimine.
Molecular Properties
| Compound Name | N-[(E)-1-chloro-2-(1H-1,2,4-triazol-5-yl)ethenyl]methanimine |
| PubChem CID | 162496364 |
| Molecular Formula | C5H4ClN4+ |
| Molecular Weight | 155.57 g/mol |
| Exact Mass | 155.01 |
| IUPAC Name | N-[(E)-1-chloro-2-(1H-1,2,4-triazol-5-yl)ethenyl]methanimine |
| SMILES | [H]/[C+]=N/C(Cl)=C\c1ncn[nH]1 |
| InChI | InChI=1S/C5H4ClN4/c1-7-4(6)2-5-8-3-9-10-5/h1-3H,(H,8,9,10)/q+1/b4-2- |
| InChIKey | SZPCPDGPDPHUPH-RQOWECAXSA-N |
| XLogP | 0.92 |
| TPSA | 53.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 155.57 |
| LogP ≤ 5 | 0.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'N-C-halo', 'substructure': 'N/A'} |
|---|
Analyze N-[(E)-1-chloro-2-(1H-1,2,4-triazol-5-yl)ethenyl]methanimine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[(E)-1-chloro-2-(1H-1,2,4-triazol-5-yl)ethenyl]methanimine?
The IUPAC name of N-[(E)-1-chloro-2-(1H-1,2,4-triazol-5-yl)ethenyl]methanimine (CID 162496364) is N-[(E)-1-chloro-2-(1H-1,2,4-triazol-5-yl)ethenyl]methanimine.
What is the SMILES notation for N-[(E)-1-chloro-2-(1H-1,2,4-triazol-5-yl)ethenyl]methanimine?
The canonical SMILES for N-[(E)-1-chloro-2-(1H-1,2,4-triazol-5-yl)ethenyl]methanimine is [H]/[C+]=N/C(Cl)=C\c1ncn[nH]1.
What is the InChIKey of N-[(E)-1-chloro-2-(1H-1,2,4-triazol-5-yl)ethenyl]methanimine?
The InChIKey is SZPCPDGPDPHUPH-RQOWECAXSA-N. The full InChI is InChI=1S/C5H4ClN4/c1-7-4(6)2-5-8-3-9-10-5/h1-3H,(H,8,9,10)/q+1/b4-2-.
What are the key properties of N-[(E)-1-chloro-2-(1H-1,2,4-triazol-5-yl)ethenyl]methanimine?
N-[(E)-1-chloro-2-(1H-1,2,4-triazol-5-yl)ethenyl]methanimine has a molecular weight of 155.57 g/mol, XLogP of 0.92, 2 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for N-[(E)-1-chloro-2-(1H-1,2,4-triazol-5-yl)ethenyl]methanimine is sourced from PubChem (CID 162496364), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).