C23H23I2O+ — CID 162496497
(4-tert-butylphenyl)-[4-(4-iodophenoxy)-2-methylphenyl]iodanium (PubChem CID 162496497) has the molecular formula C23H23I2O+ and a molecular weight of 569.24 g/mol. Its IUPAC name is (4-tert-butylphenyl)-[4-(4-iodophenoxy)-2-methylphenyl]iodanium.
| Compound Name | (4-tert-butylphenyl)-[4-(4-iodophenoxy)-2-methylphenyl]iodanium |
|---|---|
| PubChem CID | 162496497 |
| Molecular Formula | C23H23I2O+ |
| Molecular Weight | 569.24 g/mol |
| Exact Mass | 568.98 |
| IUPAC Name | (4-tert-butylphenyl)-[4-(4-iodophenoxy)-2-methylphenyl]iodanium |
| SMILES | Cc1cc(Oc2ccc(I)cc2)ccc1[I+]c1ccc(C(C)(C)C)cc1 |
| InChI | InChI=1S/C23H23I2O/c1-16-15-21(26-20-11-7-18(24)8-12-20)13-14-22(16)25-19-9-5-17(6-10-19)23(2,3)4/h5-15H,1-4H3/q+1 |
| InChIKey | STWFWBNGKOAHTD-UHFFFAOYSA-N |
| XLogP | 3.82 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 569.24 |
| LogP ≤ 5 | 3.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|