About (E)-2-[(2-butyl-1,3-benzoxazol-5-yl)oxymethyl]-3-fluoroprop-2-en-1-amine
(E)-2-[(2-butyl-1,3-benzoxazol-5-yl)oxymethyl]-3-fluoroprop-2-en-1-amine (PubChem CID 162496708) has the molecular formula C15H19FN2O2
and a molecular weight of 278.33 g/mol. Its IUPAC name is (E)-2-[(2-butyl-1,3-benzoxazol-5-yl)oxymethyl]-3-fluoroprop-2-en-1-amine.
Molecular Properties
| Compound Name | (E)-2-[(2-butyl-1,3-benzoxazol-5-yl)oxymethyl]-3-fluoroprop-2-en-1-amine |
| PubChem CID | 162496708 |
| Molecular Formula | C15H19FN2O2 |
| Molecular Weight | 278.33 g/mol |
| Exact Mass | 278.14 |
| IUPAC Name | (E)-2-[(2-butyl-1,3-benzoxazol-5-yl)oxymethyl]-3-fluoroprop-2-en-1-amine |
| SMILES | CCCCc1nc2cc(OC/C(=C/F)CN)ccc2o1 |
| InChI | InChI=1S/C15H19FN2O2/c1-2-3-4-15-18-13-7-12(5-6-14(13)20-15)19-10-11(8-16)9-17/h5-8H,2-4,9-10,17H2,1H3/b11-8+ |
| InChIKey | AZSJKVHFYXGIAB-DHZHZOJOSA-N |
| XLogP | 3.36 |
| TPSA | 61.28 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 278.33 |
| LogP ≤ 5 | 3.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze (E)-2-[(2-butyl-1,3-benzoxazol-5-yl)oxymethyl]-3-fluoroprop-2-en-1-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (E)-2-[(2-butyl-1,3-benzoxazol-5-yl)oxymethyl]-3-fluoroprop-2-en-1-amine?
The IUPAC name of (E)-2-[(2-butyl-1,3-benzoxazol-5-yl)oxymethyl]-3-fluoroprop-2-en-1-amine (CID 162496708) is (E)-2-[(2-butyl-1,3-benzoxazol-5-yl)oxymethyl]-3-fluoroprop-2-en-1-amine.
What is the SMILES notation for (E)-2-[(2-butyl-1,3-benzoxazol-5-yl)oxymethyl]-3-fluoroprop-2-en-1-amine?
The canonical SMILES for (E)-2-[(2-butyl-1,3-benzoxazol-5-yl)oxymethyl]-3-fluoroprop-2-en-1-amine is CCCCc1nc2cc(OC/C(=C/F)CN)ccc2o1.
What is the InChIKey of (E)-2-[(2-butyl-1,3-benzoxazol-5-yl)oxymethyl]-3-fluoroprop-2-en-1-amine?
The InChIKey is AZSJKVHFYXGIAB-DHZHZOJOSA-N. The full InChI is InChI=1S/C15H19FN2O2/c1-2-3-4-15-18-13-7-12(5-6-14(13)20-15)19-10-11(8-16)9-17/h5-8H,2-4,9-10,17H2,1H3/b11-8+.
What are the key properties of (E)-2-[(2-butyl-1,3-benzoxazol-5-yl)oxymethyl]-3-fluoroprop-2-en-1-amine?
(E)-2-[(2-butyl-1,3-benzoxazol-5-yl)oxymethyl]-3-fluoroprop-2-en-1-amine has a molecular weight of 278.33 g/mol, XLogP of 3.36, 7 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for (E)-2-[(2-butyl-1,3-benzoxazol-5-yl)oxymethyl]-3-fluoroprop-2-en-1-amine is sourced from PubChem (CID 162496708), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).