C20H9NO2 — CID 162497244
N-methoxy-N-methyloctadeca-2,4,6,8,10,12,14,16-octaynamide (PubChem CID 162497244) has the molecular formula C20H9NO2 and a molecular weight of 295.30 g/mol. Its IUPAC name is N-methoxy-N-methyloctadeca-2,4,6,8,10,12,14,16-octaynamide.
| Compound Name | N-methoxy-N-methyloctadeca-2,4,6,8,10,12,14,16-octaynamide |
|---|---|
| PubChem CID | 162497244 |
| Molecular Formula | C20H9NO2 |
| Molecular Weight | 295.30 g/mol |
| Exact Mass | 295.06 |
| IUPAC Name | N-methoxy-N-methyloctadeca-2,4,6,8,10,12,14,16-octaynamide |
| SMILES | CC#CC#CC#CC#CC#CC#CC#CC#CC(=O)N(C)OC |
| InChI | InChI=1S/C20H9NO2/c1-4-5-6-7-8-9-10-11-12-13-14-15-16-17-18-19-20(22)21(2)23-3/h1-3H3 |
| InChIKey | AEMMMGKTGTYMKM-UHFFFAOYSA-N |
| XLogP | 0.05 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.30 |
| LogP ≤ 5 | 0.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|