C21H40O4Si — CID 162497677
8-[3-[tert-butyl(dimethyl)silyl]oxybutyl]-6,6,8-trimethyl-1,4-dioxaspiro[4.5]decan-7-one (PubChem CID 162497677) has the molecular formula C21H40O4Si and a molecular weight of 384.63 g/mol. Its IUPAC name is 8-[3-[tert-butyl(dimethyl)silyl]oxybutyl]-6,6,8-trimethyl-1,4-dioxaspiro[4.5]decan-7-one.
| Compound Name | 8-[3-[tert-butyl(dimethyl)silyl]oxybutyl]-6,6,8-trimethyl-1,4-dioxaspiro[4.5]decan-7-one |
|---|---|
| PubChem CID | 162497677 |
| Molecular Formula | C21H40O4Si |
| Molecular Weight | 384.63 g/mol |
| Exact Mass | 384.27 |
| IUPAC Name | 8-[3-[tert-butyl(dimethyl)silyl]oxybutyl]-6,6,8-trimethyl-1,4-dioxaspiro[4.5]decan-7-one |
| SMILES | CC(CCC1(C)CCC2(OCCO2)C(C)(C)C1=O)O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C21H40O4Si/c1-16(25-26(8,9)18(2,3)4)10-11-20(7)12-13-21(23-14-15-24-21)19(5,6)17(20)22/h16H,10-15H2,1-9H3 |
| InChIKey | AKCBSGVVFVDYFV-UHFFFAOYSA-N |
| XLogP | 5.32 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.63 |
| LogP ≤ 5 | 5.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|