About 2-adamantyl 3-[4-(thiolan-1-ium-1-yl)naphthalen-1-yl]propanoate
2-adamantyl 3-[4-(thiolan-1-ium-1-yl)naphthalen-1-yl]propanoate (PubChem CID 162498568) has the molecular formula C27H33O2S+
and a molecular weight of 421.63 g/mol. Its IUPAC name is 2-adamantyl 3-[4-(thiolan-1-ium-1-yl)naphthalen-1-yl]propanoate.
Molecular Properties
| Compound Name | 2-adamantyl 3-[4-(thiolan-1-ium-1-yl)naphthalen-1-yl]propanoate |
| PubChem CID | 162498568 |
| Molecular Formula | C27H33O2S+ |
| Molecular Weight | 421.63 g/mol |
| Exact Mass | 421.22 |
| IUPAC Name | 2-adamantyl 3-[4-(thiolan-1-ium-1-yl)naphthalen-1-yl]propanoate |
| SMILES | O=C(CCc1ccc([S+]2CCCC2)c2ccccc12)OC1C2CC3CC(C2)CC1C3 |
| InChI | InChI=1S/C27H33O2S/c28-26(29-27-21-14-18-13-19(16-21)17-22(27)15-18)10-8-20-7-9-25(30-11-3-4-12-30)24-6-2-1-5-23(20)24/h1-2,5-7,9,18-19,21-22,27H,3-4,8,10-17H2/q+1 |
| InChIKey | LJZKRYQNOIWCFK-UHFFFAOYSA-N |
| XLogP | 5.91 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 421.63 |
| LogP ≤ 5 | 5.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'} |
|---|
Analyze 2-adamantyl 3-[4-(thiolan-1-ium-1-yl)naphthalen-1-yl]propanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-adamantyl 3-[4-(thiolan-1-ium-1-yl)naphthalen-1-yl]propanoate?
The IUPAC name of 2-adamantyl 3-[4-(thiolan-1-ium-1-yl)naphthalen-1-yl]propanoate (CID 162498568) is 2-adamantyl 3-[4-(thiolan-1-ium-1-yl)naphthalen-1-yl]propanoate.
What is the SMILES notation for 2-adamantyl 3-[4-(thiolan-1-ium-1-yl)naphthalen-1-yl]propanoate?
The canonical SMILES for 2-adamantyl 3-[4-(thiolan-1-ium-1-yl)naphthalen-1-yl]propanoate is O=C(CCc1ccc([S+]2CCCC2)c2ccccc12)OC1C2CC3CC(C2)CC1C3.
What is the InChIKey of 2-adamantyl 3-[4-(thiolan-1-ium-1-yl)naphthalen-1-yl]propanoate?
The InChIKey is LJZKRYQNOIWCFK-UHFFFAOYSA-N. The full InChI is InChI=1S/C27H33O2S/c28-26(29-27-21-14-18-13-19(16-21)17-22(27)15-18)10-8-20-7-9-25(30-11-3-4-12-30)24-6-2-1-5-23(20)24/h1-2,5-7,9,18-19,21-22,27H,3-4,8,10-17H2/q+1.
What are the key properties of 2-adamantyl 3-[4-(thiolan-1-ium-1-yl)naphthalen-1-yl]propanoate?
2-adamantyl 3-[4-(thiolan-1-ium-1-yl)naphthalen-1-yl]propanoate has a molecular weight of 421.63 g/mol, XLogP of 5.91, 5 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-adamantyl 3-[4-(thiolan-1-ium-1-yl)naphthalen-1-yl]propanoate is sourced from PubChem (CID 162498568), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).