C39H28Br2O4 — CID 162498648
[4-[(Z)-2-[6,20-dibromo-16-[(Z)-2-[4-(hydroxymethyl)phenyl]ethenyl]-12,14-dioxapentacyclo[13.8.0.02,11.03,8.018,23]tricosa-1(23),2,4,6,8,10,15,17,19,21-decaen-10-yl]ethenyl]phenyl]methanol (PubChem CID 162498648) has the molecular formula C39H28Br2O4 and a molecular weight of 720.46 g/mol. Its IUPAC name is [4-[(Z)-2-[6,20-dibromo-16-[(Z)-2-[4-(hydroxymethyl)phenyl]ethenyl]-12,14-dioxapentacyclo[13.8.0.02,11.03,8.018,23]tricosa-1(23),2,4,6,8,10,15,17,19,21-decaen-10-yl]ethenyl]phenyl]methanol.
| Compound Name | [4-[(Z)-2-[6,20-dibromo-16-[(Z)-2-[4-(hydroxymethyl)phenyl]ethenyl]-12,14-dioxapentacyclo[13.8.0.02,11.03,8.018,23]tricosa-1(23),2,4,6,8,10,15,17,19,21-decaen-10-yl]ethenyl]phenyl]methanol |
|---|---|
| PubChem CID | 162498648 |
| Molecular Formula | C39H28Br2O4 |
| Molecular Weight | 720.46 g/mol |
| Exact Mass | 718.04 |
| IUPAC Name | [4-[(Z)-2-[6,20-dibromo-16-[(Z)-2-[4-(hydroxymethyl)phenyl]ethenyl]-12,14-dioxapentacyclo[13.8.0.02,11.03,8.018,23]tricosa-1(23),2,4,6,8,10,15,17,19,21-decaen-10-yl]ethenyl]phenyl]methanol |
| SMILES | OCc1ccc(/C=C\c2cc3cc(Br)ccc3c3c2OCOc2c(/C=C\c4ccc(CO)cc4)cc4cc(Br)ccc4c2-3)cc1 |
| InChI | InChI=1S/C39H28Br2O4/c40-32-13-15-34-30(19-32)17-28(11-9-24-1-5-26(21-42)6-2-24)38-36(34)37-35-16-14-33(41)20-31(35)18-29(39(37)45-23-44-38)12-10-25-3-7-27(22-43)8-4-25/h1-20,42-43H,21-23H2/b11-9-,12-10- |
| InChIKey | GKUIGRMNMDPYBW-HWAYABPNSA-N |
| XLogP | 10.24 |
| TPSA | 58.92 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 720.46 |
| LogP ≤ 5 | 10.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|