C51H34O6 — CID 162498685
[3-[(Z)-2-[16-[(Z)-2-(3-benzoyloxyphenyl)ethenyl]-12,14-dioxapentacyclo[13.8.0.02,11.03,8.018,23]tricosa-1(15),2(11),3,5,7,9,16,18,20,22-decaen-10-yl]ethenyl]phenyl] benzoate (PubChem CID 162498685) has the molecular formula C51H34O6 and a molecular weight of 742.83 g/mol. Its IUPAC name is [3-[(Z)-2-[16-[(Z)-2-(3-benzoyloxyphenyl)ethenyl]-12,14-dioxapentacyclo[13.8.0.02,11.03,8.018,23]tricosa-1(15),2(11),3,5,7,9,16,18,20,22-decaen-10-yl]ethenyl]phenyl] benzoate.
| Compound Name | [3-[(Z)-2-[16-[(Z)-2-(3-benzoyloxyphenyl)ethenyl]-12,14-dioxapentacyclo[13.8.0.02,11.03,8.018,23]tricosa-1(15),2(11),3,5,7,9,16,18,20,22-decaen-10-yl]ethenyl]phenyl] benzoate |
|---|---|
| PubChem CID | 162498685 |
| Molecular Formula | C51H34O6 |
| Molecular Weight | 742.83 g/mol |
| Exact Mass | 742.24 |
| IUPAC Name | [3-[(Z)-2-[16-[(Z)-2-(3-benzoyloxyphenyl)ethenyl]-12,14-dioxapentacyclo[13.8.0.02,11.03,8.018,23]tricosa-1(15),2(11),3,5,7,9,16,18,20,22-decaen-10-yl]ethenyl]phenyl] benzoate |
| SMILES | O=C(Oc1cccc(/C=C\c2cc3ccccc3c3c2OCOc2c(/C=C\c4cccc(OC(=O)c5ccccc5)c4)cc4ccccc4c2-3)c1)c1ccccc1 |
| InChI | InChI=1S/C51H34O6/c52-50(36-15-3-1-4-16-36)56-42-21-11-13-34(29-42)25-27-40-31-38-19-7-9-23-44(38)46-47-45-24-10-8-20-39(45)32-41(49(47)55-33-54-48(40)46)28-26-35-14-12-22-43(30-35)57-51(53)37-17-5-2-6-18-37/h1-32H,33H2/b27-25-,28-26- |
| InChIKey | RGIRRZLMQCRQBP-LBXGSASVSA-N |
| XLogP | 12.17 |
| TPSA | 71.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 57 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 742.83 |
| LogP ≤ 5 | 12.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|