C24H42O2 — CID 162498796
1,3,4,6-tetratert-butyl-1,3,3a,4,6,6a-hexahydropentalene-2,5-dione (PubChem CID 162498796) has the molecular formula C24H42O2 and a molecular weight of 362.60 g/mol. Its IUPAC name is 1,3,4,6-tetratert-butyl-1,3,3a,4,6,6a-hexahydropentalene-2,5-dione.
| Compound Name | 1,3,4,6-tetratert-butyl-1,3,3a,4,6,6a-hexahydropentalene-2,5-dione |
|---|---|
| PubChem CID | 162498796 |
| Molecular Formula | C24H42O2 |
| Molecular Weight | 362.60 g/mol |
| Exact Mass | 362.32 |
| IUPAC Name | 1,3,4,6-tetratert-butyl-1,3,3a,4,6,6a-hexahydropentalene-2,5-dione |
| SMILES | CC(C)(C)C1C(=O)C(C(C)(C)C)C2C1C(C(C)(C)C)C(=O)C2C(C)(C)C |
| InChI | InChI=1S/C24H42O2/c1-21(2,3)15-13-14(17(19(15)25)23(7,8)9)18(24(10,11)12)20(26)16(13)22(4,5)6/h13-18H,1-12H3 |
| InChIKey | OXKSGBJUROZQMT-UHFFFAOYSA-N |
| XLogP | 6.03 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.60 |
| LogP ≤ 5 | 6.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |