C19H23NO2 — CID 162498984
5-tert-butyl-7,8,9,10-tetrahydro-6H-benzo[b][1]benzazocine-11,12-dione (PubChem CID 162498984) has the molecular formula C19H23NO2 and a molecular weight of 297.40 g/mol. Its IUPAC name is 5-tert-butyl-7,8,9,10-tetrahydro-6H-benzo[b][1]benzazocine-11,12-dione.
| Compound Name | 5-tert-butyl-7,8,9,10-tetrahydro-6H-benzo[b][1]benzazocine-11,12-dione |
|---|---|
| PubChem CID | 162498984 |
| Molecular Formula | C19H23NO2 |
| Molecular Weight | 297.40 g/mol |
| Exact Mass | 297.17 |
| IUPAC Name | 5-tert-butyl-7,8,9,10-tetrahydro-6H-benzo[b][1]benzazocine-11,12-dione |
| SMILES | CC(C)(C)N1C2=C(CCCC2)CC(=O)C(=O)c2ccccc21 |
| InChI | InChI=1S/C19H23NO2/c1-19(2,3)20-15-10-6-4-8-13(15)12-17(21)18(22)14-9-5-7-11-16(14)20/h5,7,9,11H,4,6,8,10,12H2,1-3H3 |
| InChIKey | IIYCZJVHMOIEJU-UHFFFAOYSA-N |
| XLogP | 4.28 |
| TPSA | 37.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.40 |
| LogP ≤ 5 | 4.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|