C32H37B2N4O2Pd- — CID 162499295
[2,3-bis(dimethylamino)-4-phenyl-1-phenyl-1,4,2,3-diazadiborolidin-5-ylidene]palladium;1,3-diphenylpropane-1,3-diol (PubChem CID 162499295) has the molecular formula C32H37B2N4O2Pd- and a molecular weight of 637.72 g/mol. Its IUPAC name is [2,3-bis(dimethylamino)-4-phenyl-1-phenyl-1,4,2,3-diazadiborolidin-5-ylidene]palladium;1,3-diphenylpropane-1,3-diol.
| Compound Name | [2,3-bis(dimethylamino)-4-phenyl-1-phenyl-1,4,2,3-diazadiborolidin-5-ylidene]palladium;1,3-diphenylpropane-1,3-diol |
|---|---|
| PubChem CID | 162499295 |
| Molecular Formula | C32H37B2N4O2Pd- |
| Molecular Weight | 637.72 g/mol |
| Exact Mass | 637.21 |
| IUPAC Name | [2,3-bis(dimethylamino)-4-phenyl-1-phenyl-1,4,2,3-diazadiborolidin-5-ylidene]palladium;1,3-diphenylpropane-1,3-diol |
| SMILES | CN(C)B1B(N(C)C)N(c2ccccc2)C(=[Pd])N1c1[c-]cccc1.OC(CC(O)c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C17H21B2N4.C15H16O2.Pd/c1-20(2)18-19(21(3)4)23(17-13-9-6-10-14-17)15-22(18)16-11-7-5-8-12-16;16-14(12-7-3-1-4-8-12)11-15(17)13-9-5-2-6-10-13;/h5-13H,1-4H3;1-10,14-17H,11H2;/q-1;; |
| InChIKey | UCRQVEPTGIRHCX-UHFFFAOYSA-N |
| XLogP | 4.47 |
| TPSA | 53.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 637.72 |
| LogP ≤ 5 | 4.47 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|