C48H40Ag2P2+2 — CID 162499643
disilver;bis(9-ethynylanthracene);methyl-[2-[methyl(phenyl)phosphaniumyl]ethyl]-phenylphosphanium (PubChem CID 162499643) has the molecular formula C48H40Ag2P2+2 and a molecular weight of 894.53 g/mol. Its IUPAC name is disilver;bis(9-ethynylanthracene);methyl-[2-[methyl(phenyl)phosphaniumyl]ethyl]-phenylphosphanium.
| Compound Name | disilver;bis(9-ethynylanthracene);methyl-[2-[methyl(phenyl)phosphaniumyl]ethyl]-phenylphosphanium |
|---|---|
| PubChem CID | 162499643 |
| Molecular Formula | C48H40Ag2P2+2 |
| Molecular Weight | 894.53 g/mol |
| Exact Mass | 892.07 |
| IUPAC Name | disilver;bis(9-ethynylanthracene);methyl-[2-[methyl(phenyl)phosphaniumyl]ethyl]-phenylphosphanium |
| SMILES | C[PH+](CC[PH+](C)c1ccccc1)c1ccccc1.[Ag+].[Ag+].[C-]#Cc1c2ccccc2cc2ccccc12.[C-]#Cc1c2ccccc2cc2ccccc12 |
| InChI | InChI=1S/C16H20P2.2C16H9.2Ag/c1-17(15-9-5-3-6-10-15)13-14-18(2)16-11-7-4-8-12-16;2*1-2-14-15-9-5-3-7-12(15)11-13-8-4-6-10-16(13)14;;/h3-12H,13-14H2,1-2H3;2*3-11H;;/q;2*-1;2*+1/p+2 |
| InChIKey | OSSHNYKQAHRKOW-UHFFFAOYSA-P |
| XLogP | 11.18 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 5 |
| Heavy Atoms | 52 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 894.53 |
| LogP ≤ 5 | 11.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|