C7H10N3O2S- — CID 162499913
5-methyl-6,7-dihydro-4H-pyrazolo[1,5-a]pyrazine-2-sulfinate (PubChem CID 162499913) has the molecular formula C7H10N3O2S- and a molecular weight of 200.24 g/mol. Its IUPAC name is 5-methyl-6,7-dihydro-4H-pyrazolo[1,5-a]pyrazine-2-sulfinate.
| Compound Name | 5-methyl-6,7-dihydro-4H-pyrazolo[1,5-a]pyrazine-2-sulfinate |
|---|---|
| PubChem CID | 162499913 |
| Molecular Formula | C7H10N3O2S- |
| Molecular Weight | 200.24 g/mol |
| Exact Mass | 200.05 |
| IUPAC Name | 5-methyl-6,7-dihydro-4H-pyrazolo[1,5-a]pyrazine-2-sulfinate |
| SMILES | CN1CCn2nc(S(=O)[O-])cc2C1 |
| InChI | InChI=1S/C7H11N3O2S/c1-9-2-3-10-6(5-9)4-7(8-10)13(11)12/h4H,2-3,5H2,1H3,(H,11,12)/p-1 |
| InChIKey | NRFAMBRAPKQSNA-UHFFFAOYSA-M |
| XLogP | -0.43 |
| TPSA | 61.19 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 200.24 |
| LogP ≤ 5 | -0.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'sulfinic_acid', 'substructure': 'N/A'} |
|---|