C38H37F3IrNO3S- — CID 162500373
(Z)-3,7-diethyl-6-hydroxynon-5-en-4-one;iridium;1-(1-methyl-4H-dibenzofuran-4-id-3-yl)-8-(trifluoromethyl)-[1]benzothiolo[2,3-c]pyridine (PubChem CID 162500373) has the molecular formula C38H37F3IrNO3S- and a molecular weight of 837.00 g/mol. Its IUPAC name is (Z)-3,7-diethyl-6-hydroxynon-5-en-4-one;iridium;1-(1-methyl-4H-dibenzofuran-4-id-3-yl)-8-(trifluoromethyl)-[1]benzothiolo[2,3-c]pyridine.
| Compound Name | (Z)-3,7-diethyl-6-hydroxynon-5-en-4-one;iridium;1-(1-methyl-4H-dibenzofuran-4-id-3-yl)-8-(trifluoromethyl)-[1]benzothiolo[2,3-c]pyridine |
|---|---|
| PubChem CID | 162500373 |
| Molecular Formula | C38H37F3IrNO3S- |
| Molecular Weight | 837.00 g/mol |
| Exact Mass | 837.21 |
| IUPAC Name | (Z)-3,7-diethyl-6-hydroxynon-5-en-4-one;iridium;1-(1-methyl-4H-dibenzofuran-4-id-3-yl)-8-(trifluoromethyl)-[1]benzothiolo[2,3-c]pyridine |
| SMILES | CCC(CC)C(=O)/C=C(\O)C(CC)CC.Cc1cc(-c2nccc3c2sc2c(C(F)(F)F)cccc23)[c-]c2oc3ccccc3c12.[Ir] |
| InChI | InChI=1S/C25H13F3NOS.C13H24O2.Ir/c1-13-11-14(12-20-21(13)17-5-2-3-8-19(17)30-20)22-24-16(9-10-29-22)15-6-4-7-18(23(15)31-24)25(26,27)28;1-5-10(6-2)12(14)9-13(15)11(7-3)8-4;/h2-11H,1H3;9-11,14H,5-8H2,1-4H3;/q-1;;/b;12-9-; |
| InChIKey | PLDZOZOVTDNUNR-DZTQYQPZSA-N |
| XLogP | 12.01 |
| TPSA | 63.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 837.00 |
| LogP ≤ 5 | 12.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|