About 6-amino-2,5-ditert-butyl-3-methylpyrimidin-4-one
6-amino-2,5-ditert-butyl-3-methylpyrimidin-4-one (PubChem CID 162501135) has the molecular formula C13H23N3O
and a molecular weight of 237.35 g/mol. Its IUPAC name is 6-amino-2,5-ditert-butyl-3-methylpyrimidin-4-one.
Molecular Properties
| Compound Name | 6-amino-2,5-ditert-butyl-3-methylpyrimidin-4-one |
| PubChem CID | 162501135 |
| Molecular Formula | C13H23N3O |
| Molecular Weight | 237.35 g/mol |
| Exact Mass | 237.18 |
| IUPAC Name | 6-amino-2,5-ditert-butyl-3-methylpyrimidin-4-one |
| SMILES | Cn1c(C(C)(C)C)nc(N)c(C(C)(C)C)c1=O |
| InChI | InChI=1S/C13H23N3O/c1-12(2,3)8-9(14)15-11(13(4,5)6)16(7)10(8)17/h14H2,1-7H3 |
| InChIKey | ZMVDFISYOYQGFV-UHFFFAOYSA-N |
| XLogP | 1.96 |
| TPSA | 60.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 237.35 |
| LogP ≤ 5 | 1.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 6-amino-2,5-ditert-butyl-3-methylpyrimidin-4-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-amino-2,5-ditert-butyl-3-methylpyrimidin-4-one?
The IUPAC name of 6-amino-2,5-ditert-butyl-3-methylpyrimidin-4-one (CID 162501135) is 6-amino-2,5-ditert-butyl-3-methylpyrimidin-4-one.
What is the SMILES notation for 6-amino-2,5-ditert-butyl-3-methylpyrimidin-4-one?
The canonical SMILES for 6-amino-2,5-ditert-butyl-3-methylpyrimidin-4-one is Cn1c(C(C)(C)C)nc(N)c(C(C)(C)C)c1=O.
What is the InChIKey of 6-amino-2,5-ditert-butyl-3-methylpyrimidin-4-one?
The InChIKey is ZMVDFISYOYQGFV-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H23N3O/c1-12(2,3)8-9(14)15-11(13(4,5)6)16(7)10(8)17/h14H2,1-7H3.
What are the key properties of 6-amino-2,5-ditert-butyl-3-methylpyrimidin-4-one?
6-amino-2,5-ditert-butyl-3-methylpyrimidin-4-one has a molecular weight of 237.35 g/mol, XLogP of 1.96, 0 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 6-amino-2,5-ditert-butyl-3-methylpyrimidin-4-one is sourced from PubChem (CID 162501135), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).