C67H36F9N7 — CID 162503006
9,9-bis[4-(4,6-diphenyl-1,3,5-triazin-2-yl)phenyl]-10-[2,3,5,6-tetrafluoro-4-(2,3,4,5,6-pentafluorophenyl)phenyl]acridine (PubChem CID 162503006) has the molecular formula C67H36F9N7 and a molecular weight of 1110.06 g/mol. Its IUPAC name is 9,9-bis[4-(4,6-diphenyl-1,3,5-triazin-2-yl)phenyl]-10-[2,3,5,6-tetrafluoro-4-(2,3,4,5,6-pentafluorophenyl)phenyl]acridine.
| Compound Name | 9,9-bis[4-(4,6-diphenyl-1,3,5-triazin-2-yl)phenyl]-10-[2,3,5,6-tetrafluoro-4-(2,3,4,5,6-pentafluorophenyl)phenyl]acridine |
|---|---|
| PubChem CID | 162503006 |
| Molecular Formula | C67H36F9N7 |
| Molecular Weight | 1110.06 g/mol |
| Exact Mass | 1109.29 |
| IUPAC Name | 9,9-bis[4-(4,6-diphenyl-1,3,5-triazin-2-yl)phenyl]-10-[2,3,5,6-tetrafluoro-4-(2,3,4,5,6-pentafluorophenyl)phenyl]acridine |
| SMILES | Fc1c(F)c(F)c(-c2c(F)c(F)c(N3c4ccccc4C(c4ccc(-c5nc(-c6ccccc6)nc(-c6ccccc6)n5)cc4)(c4ccc(-c5nc(-c6ccccc6)nc(-c6ccccc6)n5)cc4)c4ccccc43)c(F)c2F)c(F)c1F |
| InChI | InChI=1S/C67H36F9N7/c68-51-49(52(69)56(73)57(74)55(51)72)50-53(70)58(75)60(59(76)54(50)71)83-47-27-15-13-25-45(47)67(46-26-14-16-28-48(46)83,43-33-29-41(30-34-43)65-79-61(37-17-5-1-6-18-37)77-62(80-65)38-19-7-2-8-20-38)44-35-31-42(32-36-44)66-81-63(39-21-9-3-10-22-39)78-64(82-66)40-23-11-4-12-24-40/h1-36H |
| InChIKey | OFDCSYDNENVFQR-UHFFFAOYSA-N |
| XLogP | 17.14 |
| TPSA | 80.58 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 83 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 1110.06 |
| LogP ≤ 5 | 17.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|